|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
MP2=FULL/6-311+G(3df,2p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6698 |
-0.1305 |
0.0000 |
|
0.3786 |
-0.5526 |
-0.1305 |
| H2 |
-1.5707 |
0.4688 |
0.0000 |
|
0.8878 |
-1.2958 |
0.4688 |
| Br3 |
0.8104 |
1.0950 |
0.0000 |
|
-0.4581 |
0.6685 |
1.0950 |
| Cl4 |
-0.6698 |
-1.1180 |
1.4438 |
|
1.5697 |
0.2635 |
-1.1180 |
| Cl5 |
-0.6698 |
-1.1180 |
-1.4438 |
|
-0.8125 |
-1.3687 |
-1.1180 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0820 |
1.9217 |
1.7493 |
1.7493 |
| H2 |
1.0820 |
| 2.4621 |
2.3268 |
2.3268 |
| Br3 |
1.9217 |
2.4621 |
| 3.0288 |
3.0288 |
| Cl4 |
1.7493 |
2.3268 |
3.0288 |
| 2.8877 |
| Cl5 |
1.7493 |
2.3268 |
3.0288 |
2.8877 |
|
Maximum atom distance is 3.0288Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.101 |
|
Br3 |
C1 |
Cl5 |
111.101 |
|
Cl4 |
C1 |
Cl5 |
111.258 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.749 |
|
H2 |
C1 |
Cl4 |
108.220 |
|
H2 |
C1 |
Cl5 |
108.220 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.