|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH(NH2)CH3 (2-Propanamine)
1A' CS
1910171554
InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3 INChIKey=JJWLVOIRVHMVIS-UHFFFAOYSA-N
HF/6-311+G(3df,2p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.2882 |
0.2139 |
0.0000 |
|
-0.2137 |
-0.0089 |
0.2882 |
| N2 |
-0.8963 |
1.0631 |
0.0000 |
|
-1.0622 |
-0.0443 |
-0.8963 |
| H3 |
1.2035 |
0.8085 |
0.0000 |
|
-0.8078 |
-0.0337 |
1.2035 |
| C4 |
0.2882 |
-0.6419 |
1.2594 |
|
0.6938 |
-1.2316 |
0.2882 |
| C5 |
0.2882 |
-0.6419 |
-1.2594 |
|
0.5889 |
1.2850 |
0.2882 |
| H6 |
-0.9223 |
1.6530 |
-0.8051 |
|
-1.6851 |
0.7356 |
-0.9223 |
| H7 |
-0.9223 |
1.6530 |
0.8051 |
|
-1.6180 |
-0.8733 |
-0.9223 |
| H8 |
-0.5933 |
-1.2716 |
1.2901 |
|
1.3243 |
-1.2360 |
-0.5933 |
| H9 |
-0.5933 |
-1.2716 |
-1.2901 |
|
1.2168 |
1.3419 |
-0.5933 |
| H10 |
1.1679 |
-1.2741 |
1.2954 |
|
1.3269 |
-1.2413 |
1.1679 |
| H11 |
1.1679 |
-1.2741 |
-1.2954 |
|
1.2190 |
1.3474 |
1.1679 |
| H12 |
0.2893 |
-0.0227 |
2.1506 |
|
0.1122 |
-2.1478 |
0.2893 |
| H13 |
0.2893 |
-0.0227 |
-2.1506 |
|
-0.0669 |
2.1497 |
0.2893 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| C1 |
|
1.4574 |
1.0915 |
1.5226 |
1.5226 |
2.0456 |
2.0456 |
2.1559 |
2.1559 |
2.1601 |
2.1601 |
2.1636 |
2.1636 |
| N2 |
1.4574 |
| 2.1151 |
2.4281 |
2.4281 |
0.9984 |
0.9984 |
2.6846 |
2.6846 |
3.3766 |
3.3766 |
2.6850 |
2.6850 |
| H3 |
1.0915 |
2.1151 |
| 2.1278 |
2.1278 |
2.4249 |
2.4249 |
3.0364 |
3.0364 |
2.4529 |
2.4529 |
2.4803 |
2.4803 |
| C4 |
1.5226 |
2.4281 |
2.1278 |
| 2.5188 |
3.3157 |
2.6340 |
1.0837 |
2.7701 |
1.0839 |
2.7750 |
1.0852 |
3.4657 |
| C5 |
1.5226 |
2.4281 |
2.1278 |
2.5188 |
| 2.6340 |
3.3157 |
2.7701 |
1.0837 |
2.7750 |
1.0839 |
3.4657 |
1.0852 |
| H6 |
2.0456 |
0.9984 |
2.4249 |
3.3157 |
2.6340 |
| 1.6102 |
3.6127 |
2.9828 |
4.1652 |
3.6300 |
3.6072 |
2.4670 |
| H7 |
2.0456 |
0.9984 |
2.4249 |
2.6340 |
3.3157 |
1.6102 |
| 2.9828 |
3.6127 |
3.6300 |
4.1652 |
2.4670 |
3.6072 |
| H8 |
2.1559 |
2.6846 |
3.0364 |
1.0837 |
2.7701 |
3.6127 |
2.9828 |
| 2.5802 |
1.7612 |
3.1284 |
1.7548 |
3.7653 |
| H9 |
2.1559 |
2.6846 |
3.0364 |
2.7701 |
1.0837 |
2.9828 |
3.6127 |
2.5802 |
| 3.1284 |
1.7612 |
3.7653 |
1.7548 |
| H10 |
2.1601 |
3.3766 |
2.4529 |
1.0839 |
2.7750 |
4.1652 |
3.6300 |
1.7612 |
3.1284 |
| 2.5909 |
1.7519 |
3.7700 |
| H11 |
2.1601 |
3.3766 |
2.4529 |
2.7750 |
1.0839 |
3.6300 |
4.1652 |
3.1284 |
1.7612 |
2.5909 |
| 3.7700 |
1.7519 |
| H12 |
2.1636 |
2.6850 |
2.4803 |
1.0852 |
3.4657 |
3.6072 |
2.4670 |
1.7548 |
3.7653 |
1.7519 |
3.7700 |
| 4.3012 |
| H13 |
2.1636 |
2.6850 |
2.4803 |
3.4657 |
1.0852 |
2.4670 |
3.6072 |
3.7653 |
1.7548 |
3.7700 |
1.7519 |
4.3012 |
|
Maximum atom distance is 4.3012Å
between atoms H12 and H13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
C4 |
109.116 |
|
N2 |
C1 |
C5 |
109.116 |
|
C4 |
C1 |
C5 |
111.609 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
H6 |
111.433 |
|
C1 |
N2 |
H7 |
111.433 |
|
C1 |
C4 |
H8 |
110.490 |
|
C1 |
C4 |
H10 |
110.813 |
|
C1 |
C4 |
H12 |
111.015 |
|
C1 |
C5 |
H9 |
110.490 |
|
C1 |
C5 |
H11 |
110.813 |
|
C1 |
C5 |
H13 |
111.015 |
|
N2 |
C1 |
H3 |
111.348 |
|
H3 |
C1 |
C4 |
107.830 |
|
H3 |
C1 |
C5 |
107.830 |
|
H6 |
N2 |
H7 |
107.486 |
|
H8 |
C4 |
H10 |
108.676 |
|
H8 |
C4 |
H12 |
108.005 |
|
H9 |
C5 |
H11 |
108.676 |
|
H9 |
C5 |
H13 |
108.005 |
|
H10 |
C4 |
H12 |
107.738 |
|
H11 |
C5 |
H13 |
107.738 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.