|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCCH (3-butyn-2-one)
1A' CS
1910171554
InChI=1S/C4H4O/c1-3-4(2)5/h1H,2H3 INChIKey=XRGPFNGLRSIPSA-UHFFFAOYSA-N
MP3/6-311+G(3df,2p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.4902 |
0.7211 |
0.0000 |
|
0.1461 |
1.6491 |
0.0000 |
| C2 |
0.0000 |
0.5036 |
0.0000 |
|
0.4709 |
0.1785 |
0.0000 |
| O3 |
-0.8020 |
1.3976 |
0.0000 |
|
1.5912 |
-0.2545 |
0.0000 |
| C4 |
-0.4317 |
-0.8977 |
0.0000 |
|
-0.6864 |
-0.7218 |
0.0000 |
| C5 |
-0.7427 |
-2.0575 |
0.0000 |
|
-1.6607 |
-1.4238 |
0.0000 |
| H6 |
1.7034 |
1.7853 |
0.0000 |
|
1.0657 |
2.2256 |
0.0000 |
| H7 |
1.9292 |
0.2469 |
0.8776 |
|
-0.4529 |
1.8914 |
0.8776 |
| H8 |
1.9292 |
0.2469 |
-0.8776 |
|
-0.4529 |
1.8914 |
-0.8776 |
| H9 |
-1.0410 |
-3.0772 |
0.0000 |
|
-2.5085 |
-2.0641 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
|
1.5060 |
2.3900 |
2.5128 |
3.5647 |
1.0853 |
1.0898 |
1.0898 |
4.5645 |
| C2 |
1.5060 |
|
1.2010 |
1.4663 |
2.6667 |
2.1317 |
2.1349 |
2.1349 |
3.7291 |
| O3 |
2.3900 |
1.2010 |
| 2.3250 |
3.4557 |
2.5351 |
3.0909 |
3.0909 |
4.4812 |
| C4 |
2.5128 |
1.4663 |
2.3250 |
|
1.2008 |
3.4288 |
2.7666 |
2.7666 |
2.2631 |
| C5 |
3.5647 |
2.6667 |
3.4557 |
1.2008 |
| 4.5553 |
3.6359 |
3.6359 |
1.0624 |
| H6 |
1.0853 |
2.1317 |
2.5351 |
3.4288 |
4.5553 |
| 1.7855 |
1.7855 |
5.5835 |
| H7 |
1.0898 |
2.1349 |
3.0909 |
2.7666 |
3.6359 |
1.7855 |
| 1.7553 |
4.5434 |
| H8 |
1.0898 |
2.1349 |
3.0909 |
2.7666 |
3.6359 |
1.7855 |
1.7553 |
| 4.5434 |
| H9 |
4.5645 |
3.7291 |
4.4812 |
2.2631 |
1.0624 |
5.5835 |
4.5434 |
4.5434 |
|
Maximum atom distance is 5.5835Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
123.588 |
|
C1 |
C2 |
C4 |
115.426 |
|
C2 |
C4 |
C5 |
177.891 |
|
O3 |
C2 |
C4 |
120.986 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H6 |
109.629 |
|
C2 |
C1 |
H7 |
109.614 |
|
C2 |
C1 |
H8 |
109.614 |
|
C4 |
C5 |
H9 |
178.707 |
|
H6 |
C1 |
H7 |
110.337 |
|
H6 |
C1 |
H8 |
110.337 |
|
H7 |
C1 |
H8 |
107.276 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.