|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CSCH3 (Thioacetone)
1A1 C2V
1910171554
InChI=1S/C3H6S/c1-3(2)4/h1-2H3 INChIKey=JTNXQVCPQMQLHK-UHFFFAOYSA-N
B97D3/6-311+G(3df,2p)
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
-0.2544 |
|
-0.2544 |
0.0000 |
0.0000 |
| S2 |
0.0000 |
0.0000 |
1.3779 |
|
1.3779 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2676 |
-1.0639 |
|
-1.0639 |
1.2676 |
0.0000 |
| C4 |
0.0000 |
-1.2676 |
-1.0639 |
|
-1.0639 |
-1.2676 |
0.0000 |
| H5 |
0.0000 |
2.1538 |
-0.4299 |
|
-0.4299 |
2.1538 |
0.0000 |
| H6 |
0.0000 |
-2.1538 |
-0.4299 |
|
-0.4299 |
-2.1538 |
0.0000 |
| H7 |
0.8782 |
1.2899 |
-1.7236 |
|
-1.7236 |
1.2899 |
0.8782 |
| H8 |
-0.8782 |
1.2899 |
-1.7236 |
|
-1.7236 |
1.2899 |
-0.8782 |
| H9 |
-0.8782 |
-1.2899 |
-1.7236 |
|
-1.7236 |
-1.2899 |
-0.8782 |
| H10 |
0.8782 |
-1.2899 |
-1.7236 |
|
-1.7236 |
-1.2899 |
0.8782 |
Atom - Atom Distances (Å)
| |
C1 |
S2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
| 1.6323 |
1.5041 |
1.5041 |
2.1610 |
2.1610 |
2.1433 |
2.1433 |
2.1433 |
2.1433 |
| S2 |
1.6323 |
| 2.7512 |
2.7512 |
2.8120 |
2.8120 |
3.4719 |
3.4719 |
3.4719 |
3.4719 |
| C3 |
1.5041 |
2.7512 |
| 2.5353 |
1.0896 |
3.4797 |
1.0986 |
1.0986 |
2.7835 |
2.7835 |
| C4 |
1.5041 |
2.7512 |
2.5353 |
| 3.4797 |
1.0896 |
2.7835 |
2.7835 |
1.0986 |
1.0986 |
| H5 |
2.1610 |
2.8120 |
1.0896 |
3.4797 |
| 4.3077 |
1.7864 |
1.7864 |
3.7821 |
3.7821 |
| H6 |
2.1610 |
2.8120 |
3.4797 |
1.0896 |
4.3077 |
| 3.7821 |
3.7821 |
1.7864 |
1.7864 |
| H7 |
2.1433 |
3.4719 |
1.0986 |
2.7835 |
1.7864 |
3.7821 |
| 1.7565 |
3.1211 |
2.5799 |
| H8 |
2.1433 |
3.4719 |
1.0986 |
2.7835 |
1.7864 |
3.7821 |
1.7565 |
| 2.5799 |
3.1211 |
| H9 |
2.1433 |
3.4719 |
2.7835 |
1.0986 |
3.7821 |
1.7864 |
3.1211 |
2.5799 |
| 1.7565 |
| H10 |
2.1433 |
3.4719 |
2.7835 |
1.0986 |
3.7821 |
1.7864 |
2.5799 |
3.1211 |
1.7565 |
|
Maximum atom distance is 4.3077Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S2 |
C1 |
C3 |
122.751 |
|
S2 |
C1 |
C4 |
122.751 |
|
C3 |
C1 |
C4 |
114.498 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
111.708 |
|
C1 |
C3 |
H7 |
109.803 |
|
C1 |
C3 |
H8 |
109.803 |
|
C1 |
C4 |
H6 |
111.708 |
|
C1 |
C4 |
H9 |
109.803 |
|
C1 |
C4 |
H10 |
109.803 |
|
H5 |
C3 |
H7 |
109.453 |
|
H5 |
C3 |
H8 |
109.453 |
|
H6 |
C4 |
H9 |
109.453 |
|
H6 |
C4 |
H10 |
109.453 |
|
H7 |
C3 |
H8 |
106.481 |
|
H9 |
C4 |
H10 |
106.481 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.