|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH7N3 (triaminomethane)
1A C3
1910171554
InChI=1S/CH7N3/c2-1(3)4/h1H,2-4H2 INChIKey=
B3LYP/CEP-31G
Point group is C3
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
0.3725 |
|
-0.0000 |
-0.0000 |
0.3725 |
H2 |
0.0000 |
0.0000 |
1.4759 |
|
-0.0000 |
-0.0000 |
1.4759 |
N3 |
0.0000 |
1.4172 |
-0.0630 |
|
1.4172 |
-0.0015 |
-0.0630 |
N4 |
1.2274 |
-0.7086 |
-0.0630 |
|
-0.7099 |
-1.2266 |
-0.0630 |
N5 |
-1.2274 |
-0.7086 |
-0.0630 |
|
-0.7074 |
1.2281 |
-0.0630 |
H6 |
0.8092 |
1.9531 |
0.2592 |
|
1.9522 |
-0.8112 |
0.2592 |
H7 |
1.2868 |
-1.6773 |
0.2592 |
|
-1.6787 |
-1.2851 |
0.2592 |
H8 |
-2.0960 |
-0.2757 |
0.2592 |
|
-0.2736 |
2.0963 |
0.2592 |
H9 |
-0.2073 |
1.5603 |
-1.0550 |
|
1.5605 |
0.2057 |
-1.0550 |
H10 |
1.4549 |
-0.6007 |
-1.0550 |
|
-0.6021 |
-1.4543 |
-1.0550 |
H11 |
-1.2476 |
-0.9597 |
-1.0550 |
|
-0.9584 |
1.2486 |
-1.0550 |
Atom - Atom Distances (Å)
|
C1 |
H2 |
N3 |
N4 |
N5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
C1 |
|
1.1034 |
1.4827 |
1.4827 |
1.4827 |
2.1171 |
2.1171 |
2.1171 |
2.1250 |
2.1250 |
2.1250 |
H2 |
1.1034 |
| 2.0921 |
2.0921 |
2.0921 |
2.4392 |
2.4392 |
2.4392 |
2.9805 |
2.9805 |
2.9805 |
N3 |
1.4827 |
2.0921 |
| 2.4547 |
2.4547 |
1.0226 |
3.3669 |
2.7135 |
1.0235 |
2.6782 |
2.8619 |
N4 |
1.4827 |
2.0921 |
2.4547 |
| 2.4547 |
2.7135 |
1.0226 |
3.3669 |
2.8619 |
1.0235 |
2.6782 |
N5 |
1.4827 |
2.0921 |
2.4547 |
2.4547 |
| 3.3669 |
2.7135 |
1.0226 |
2.6782 |
2.8619 |
1.0235 |
H6 |
2.1171 |
2.4392 |
1.0226 |
2.7135 |
3.3669 |
| 3.6617 |
3.6617 |
1.7073 |
2.9437 |
3.8003 |
H7 |
2.1171 |
2.4392 |
3.3669 |
1.0226 |
2.7135 |
3.6617 |
| 3.6617 |
3.8003 |
1.7073 |
2.9437 |
H8 |
2.1171 |
2.4392 |
2.7135 |
3.3669 |
1.0226 |
3.6617 |
3.6617 |
| 2.9437 |
3.8003 |
1.7073 |
H9 |
2.1250 |
2.9805 |
1.0235 |
2.8619 |
2.6782 |
1.7073 |
3.8003 |
2.9437 |
| 2.7263 |
2.7263 |
H10 |
2.1250 |
2.9805 |
2.6782 |
1.0235 |
2.8619 |
2.9437 |
1.7073 |
3.8003 |
2.7263 |
| 2.7263 |
H11 |
2.1250 |
2.9805 |
2.8619 |
2.6782 |
1.0235 |
3.8003 |
2.9437 |
1.7073 |
2.7263 |
2.7263 |
|
Maximum atom distance is 3.8003Å
between atoms H6 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
N3 |
C1 |
N4 |
111.750 |
|
N3 |
C1 |
N5 |
111.750 |
N4 |
C1 |
N5 |
111.750 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
N3 |
H6 |
114.098 |
|
C1 |
N3 |
H9 |
114.731 |
C1 |
N4 |
H7 |
114.098 |
|
C1 |
N4 |
H10 |
114.731 |
C1 |
N5 |
H8 |
114.098 |
|
C1 |
N5 |
H11 |
114.731 |
H2 |
C1 |
N3 |
107.083 |
|
H2 |
C1 |
N4 |
107.083 |
H2 |
C1 |
N5 |
107.083 |
|
H6 |
N3 |
H9 |
113.103 |
H7 |
N4 |
H10 |
113.103 |
|
H8 |
N5 |
H11 |
113.103 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.