|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrF2 (Methane, bromodifluoro-)
1A' CS
1910171554
InChI=1S/CHBrF2/c2-1(3)4/h1H INChIKey=GRCDJFHYVYUNHM-UHFFFAOYSA-N
HF/CEP-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.4413 |
-0.9051 |
0.0000 |
|
0.0201 |
-0.4408 |
-0.9051 |
| H2 |
-1.5137 |
-1.0026 |
0.0000 |
|
0.0688 |
-1.5121 |
-1.0026 |
| Br3 |
0.0785 |
0.9739 |
0.0000 |
|
-0.0036 |
0.0784 |
0.9739 |
| F4 |
0.0785 |
-1.5363 |
1.1098 |
|
1.1051 |
0.1289 |
-1.5363 |
| F5 |
0.0785 |
-1.5363 |
-1.1098 |
|
-1.1122 |
0.0280 |
-1.5363 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
F4 |
F5 |
| C1 |
|
1.0768 |
1.9495 |
1.3785 |
1.3785 |
| H2 |
1.0768 |
| 2.5381 |
2.0128 |
2.0128 |
| Br3 |
1.9495 |
2.5381 |
| 2.7446 |
2.7446 |
| F4 |
1.3785 |
2.0128 |
2.7446 |
| 2.2196 |
| F5 |
1.3785 |
2.0128 |
2.7446 |
2.2196 |
|
Maximum atom distance is 2.7446Å
between atoms Br3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
F4 |
109.925 |
|
Br3 |
C1 |
F5 |
109.925 |
|
F4 |
C1 |
F5 |
107.235 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
110.662 |
|
H2 |
C1 |
F4 |
109.514 |
|
H2 |
C1 |
F5 |
109.514 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.