|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
MP2/CEP-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6862 |
-0.1364 |
0.0000 |
|
0.3910 |
-0.5639 |
-0.1364 |
| H2 |
-1.6245 |
0.4407 |
0.0000 |
|
0.9256 |
-1.3350 |
0.4407 |
| Br3 |
0.8306 |
1.1717 |
0.0000 |
|
-0.4733 |
0.6826 |
1.1717 |
| Cl4 |
-0.6862 |
-1.1950 |
1.5400 |
|
1.6566 |
0.3136 |
-1.1950 |
| Cl5 |
-0.6862 |
-1.1950 |
-1.5400 |
|
-0.8747 |
-1.4414 |
-1.1950 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.1016 |
2.0029 |
1.8688 |
1.8688 |
| H2 |
1.1016 |
| 2.5616 |
2.4347 |
2.4347 |
| Br3 |
2.0029 |
2.5616 |
| 3.2052 |
3.2052 |
| Cl4 |
1.8688 |
2.4347 |
3.2052 |
| 3.0801 |
| Cl5 |
1.8688 |
2.4347 |
3.2052 |
3.0801 |
|
Maximum atom distance is 3.2052Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.713 |
|
Br3 |
C1 |
Cl5 |
111.713 |
|
Cl4 |
C1 |
Cl5 |
110.993 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
107.627 |
|
H2 |
C1 |
Cl4 |
107.265 |
|
H2 |
C1 |
Cl5 |
107.265 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.