|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CHF2 (1,1,2,2-tetrafluoroethane)
1AG C2H
1910171554
InChI=1S/C2H2F4/c3-1(4)2(5)6/h1-2H INChIKey=WXGNWUVNYMJENI-UHFFFAOYSA-N
B3LYP/CEP-31G
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.2608 |
0.7306 |
0.0000 |
|
0.0349 |
-0.2584 |
0.7306 |
| C2 |
0.2608 |
-0.7306 |
0.0000 |
|
-0.0349 |
0.2584 |
-0.7306 |
| H3 |
-1.3571 |
0.8158 |
0.0000 |
|
0.1817 |
-1.3449 |
0.8158 |
| H4 |
1.3571 |
-0.8158 |
0.0000 |
|
-0.1817 |
1.3449 |
-0.8158 |
| F5 |
0.2608 |
1.3895 |
1.1441 |
|
1.0988 |
0.4116 |
1.3895 |
| F6 |
0.2608 |
1.3895 |
-1.1441 |
|
-1.1687 |
0.1053 |
1.3895 |
| F7 |
-0.2608 |
-1.3895 |
1.1441 |
|
1.1687 |
-0.1053 |
-1.3895 |
| F8 |
-0.2608 |
-1.3895 |
-1.1441 |
|
-1.0988 |
-0.4116 |
-1.3895 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
F7 |
F8 |
| C1 |
|
1.5515 |
1.0996 |
2.2381 |
1.4195 |
1.4195 |
2.4091 |
2.4091 |
| C2 |
1.5515 |
| 2.2381 |
1.0996 |
2.4091 |
2.4091 |
1.4195 |
1.4195 |
| H3 |
1.0996 |
2.2381 |
| 3.1669 |
2.0629 |
2.0629 |
2.7156 |
2.7156 |
| H4 |
2.2381 |
1.0996 |
3.1669 |
| 2.7156 |
2.7156 |
2.0629 |
2.0629 |
| F5 |
1.4195 |
2.4091 |
2.0629 |
2.7156 |
| 2.2881 |
2.8276 |
3.6374 |
| F6 |
1.4195 |
2.4091 |
2.0629 |
2.7156 |
2.2881 |
| 3.6374 |
2.8276 |
| F7 |
2.4091 |
1.4195 |
2.7156 |
2.0629 |
2.8276 |
3.6374 |
| 2.2881 |
| F8 |
2.4091 |
1.4195 |
2.7156 |
2.0629 |
3.6374 |
2.8276 |
2.2881 |
|
Maximum atom distance is 3.6374Å
between atoms F5 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F7 |
108.281 |
|
C1 |
C2 |
F8 |
108.281 |
|
C2 |
C1 |
F5 |
108.281 |
|
C2 |
C1 |
F6 |
108.281 |
|
F5 |
C1 |
F6 |
107.400 |
|
F7 |
C2 |
F8 |
107.400 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H4 |
114.090 |
|
C2 |
C1 |
H3 |
114.090 |
|
H3 |
C1 |
F5 |
109.288 |
|
H3 |
C1 |
F6 |
109.288 |
|
H4 |
C2 |
F7 |
109.288 |
|
H4 |
C2 |
F8 |
109.288 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.