|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H6 (1-Buten-3-yne, 2-methyl-)
1A' CS
1910171554
InChI=1S/C5H6/c1-4-5(2)3/h1H,2H2,3H3 INChIKey=BOFLDKIFLIFLJA-UHFFFAOYSA-N
HF/CEP-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-1.5036 |
0.6824 |
0.0000 |
|
0.2547 |
-1.6315 |
0.0000 |
| H2 |
-1.7090 |
1.7503 |
0.0000 |
|
1.2286 |
-2.1154 |
0.0000 |
| H3 |
-1.9680 |
0.2367 |
0.8792 |
|
-0.2990 |
-1.9595 |
0.8792 |
| H4 |
-1.9680 |
0.2367 |
-0.8792 |
|
-0.2990 |
-1.9595 |
-0.8792 |
| C5 |
0.6827 |
-2.1826 |
0.0000 |
|
-1.9200 |
1.2424 |
0.0000 |
| H6 |
0.9361 |
-3.2081 |
0.0000 |
|
-2.8401 |
1.7612 |
0.0000 |
| C7 |
0.4051 |
-0.9841 |
0.0000 |
|
-0.8396 |
0.6539 |
0.0000 |
| C8 |
0.0000 |
0.4229 |
0.0000 |
|
0.4075 |
-0.1133 |
0.0000 |
| C9 |
0.9347 |
1.4024 |
0.0000 |
|
1.6015 |
0.5249 |
0.0000 |
| H10 |
1.9880 |
1.1779 |
0.0000 |
|
1.6673 |
1.5999 |
0.0000 |
| H11 |
0.6453 |
2.4425 |
0.0000 |
|
2.5261 |
-0.0326 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
C7 |
C8 |
C9 |
H10 |
H11 |
| C1 |
|
1.0875 |
1.0896 |
1.0896 |
3.6039 |
4.5922 |
2.5339 |
1.5258 |
2.5424 |
3.5266 |
2.7777 |
| H2 |
1.0875 |
| 1.7694 |
1.7694 |
4.6031 |
5.6198 |
3.4564 |
2.1640 |
2.6665 |
3.7411 |
2.4540 |
| H3 |
1.0896 |
1.7694 |
| 1.7583 |
3.6949 |
4.5906 |
2.8098 |
2.1635 |
3.2492 |
4.1604 |
3.5309 |
| H4 |
1.0896 |
1.7694 |
1.7583 |
| 3.6949 |
4.5906 |
2.8098 |
2.1635 |
3.2492 |
4.1604 |
3.5309 |
| C5 |
3.6039 |
4.6031 |
3.6949 |
3.6949 |
|
1.0563 |
1.2302 |
2.6935 |
3.5938 |
3.6051 |
4.6253 |
| H6 |
4.5922 |
5.6198 |
4.5906 |
4.5906 |
1.0563 |
| 2.2865 |
3.7497 |
4.6105 |
4.5103 |
5.6581 |
| C7 |
2.5339 |
3.4564 |
2.8098 |
2.8098 |
1.2302 |
2.2865 |
|
1.4642 |
2.4445 |
2.6795 |
3.4350 |
| C8 |
1.5258 |
2.1640 |
2.1635 |
2.1635 |
2.6935 |
3.7497 |
1.4642 |
|
1.3539 |
2.1266 |
2.1202 |
| C9 |
2.5424 |
2.6665 |
3.2492 |
3.2492 |
3.5938 |
4.6105 |
2.4445 |
1.3539 |
|
1.0770 |
1.0797 |
| H10 |
3.5266 |
3.7411 |
4.1604 |
4.1604 |
3.6051 |
4.5103 |
2.6795 |
2.1266 |
1.0770 |
| 1.8446 |
| H11 |
2.7777 |
2.4540 |
3.5309 |
3.5309 |
4.6253 |
5.6581 |
3.4350 |
2.1202 |
1.0797 |
1.8446 |
|
Maximum atom distance is 5.6581Å
between atoms H6 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C8 |
C7 |
115.853 |
|
C1 |
C8 |
C9 |
123.871 |
|
C5 |
C7 |
C8 |
176.976 |
|
C7 |
C8 |
C9 |
120.276 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
H3 |
108.732 |
|
H2 |
C1 |
H4 |
108.732 |
|
H2 |
C1 |
C8 |
110.679 |
|
H3 |
C1 |
H4 |
107.585 |
|
H3 |
C1 |
C8 |
110.515 |
|
H4 |
C1 |
C8 |
110.515 |
|
H6 |
C5 |
C7 |
179.161 |
|
C8 |
C9 |
H10 |
121.629 |
|
C8 |
C9 |
H11 |
120.791 |
|
H10 |
C9 |
H11 |
117.581 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.