|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H4O2 (4-Cyclopentene-1,3-dione)
1A1 C2V
1910171554
InChI=1S/C5H4O2/c6-4-1-2-5(7)3-4/h1-2H,3H2 INChIKey=MCFZBCCYOPSZLG-UHFFFAOYSA-N
B3LYP/CEP-31G
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.1052 |
|
1.1052 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
1.2145 |
0.1484 |
|
0.1484 |
0.0000 |
1.2145 |
| C3 |
0.0000 |
-1.2145 |
0.1484 |
|
0.1484 |
0.0000 |
-1.2145 |
| C4 |
0.0000 |
0.6879 |
-1.2705 |
|
-1.2705 |
0.0000 |
0.6879 |
| C5 |
0.0000 |
-0.6879 |
-1.2705 |
|
-1.2705 |
0.0000 |
-0.6879 |
| O6 |
0.0000 |
2.4269 |
0.4744 |
|
0.4744 |
0.0000 |
2.4269 |
| O7 |
0.0000 |
-2.4269 |
0.4744 |
|
0.4744 |
0.0000 |
-2.4269 |
| H8 |
0.8886 |
0.0000 |
1.7567 |
|
1.7567 |
0.8886 |
0.0000 |
| H9 |
-0.8886 |
0.0000 |
1.7567 |
|
1.7567 |
-0.8886 |
0.0000 |
| H10 |
0.0000 |
1.3523 |
-2.1348 |
|
-2.1348 |
0.0000 |
1.3523 |
| H11 |
0.0000 |
-1.3523 |
-2.1348 |
|
-2.1348 |
0.0000 |
-1.3523 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
O6 |
O7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5461 |
1.5461 |
2.4732 |
2.4732 |
2.5075 |
2.5075 |
1.1019 |
1.1019 |
3.5108 |
3.5108 |
| C2 |
1.5461 |
| 2.4290 |
1.5134 |
2.3733 |
1.2554 |
3.6559 |
2.2026 |
2.2026 |
2.2873 |
3.4353 |
| C3 |
1.5461 |
2.4290 |
| 2.3733 |
1.5134 |
3.6559 |
1.2554 |
2.2026 |
2.2026 |
3.4353 |
2.2873 |
| C4 |
2.4732 |
1.5134 |
2.3733 |
|
1.3759 |
2.4634 |
3.5702 |
3.2290 |
3.2290 |
1.0901 |
2.2157 |
| C5 |
2.4732 |
2.3733 |
1.5134 |
1.3759 |
| 3.5702 |
2.4634 |
3.2290 |
3.2290 |
2.2157 |
1.0901 |
| O6 |
2.5075 |
1.2554 |
3.6559 |
2.4634 |
3.5702 |
| 4.8537 |
2.8851 |
2.8851 |
2.8218 |
4.5923 |
| O7 |
2.5075 |
3.6559 |
1.2554 |
3.5702 |
2.4634 |
4.8537 |
| 2.8851 |
2.8851 |
4.5923 |
2.8218 |
| H8 |
1.1019 |
2.2026 |
2.2026 |
3.2290 |
3.2290 |
2.8851 |
2.8851 |
| 1.7773 |
4.2145 |
4.2145 |
| H9 |
1.1019 |
2.2026 |
2.2026 |
3.2290 |
3.2290 |
2.8851 |
2.8851 |
1.7773 |
| 4.2145 |
4.2145 |
| H10 |
3.5108 |
2.2873 |
3.4353 |
1.0901 |
2.2157 |
2.8218 |
4.5923 |
4.2145 |
4.2145 |
| 2.7046 |
| H11 |
3.5108 |
3.4353 |
2.2873 |
2.2157 |
1.0901 |
4.5923 |
2.8218 |
4.2145 |
4.2145 |
2.7046 |
|
Maximum atom distance is 4.8537Å
between atoms O6 and O7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
107.871 |
|
C1 |
C2 |
O6 |
126.719 |
|
C1 |
C3 |
C5 |
107.871 |
|
C1 |
C3 |
O7 |
126.719 |
|
C2 |
C1 |
C3 |
103.539 |
|
C2 |
C4 |
C5 |
110.360 |
|
C3 |
C5 |
C4 |
110.360 |
|
C4 |
C2 |
O6 |
125.410 |
|
C5 |
C3 |
O7 |
125.410 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H8 |
111.463 |
|
C2 |
C1 |
H9 |
111.463 |
|
C2 |
C4 |
H10 |
122.092 |
|
C3 |
C1 |
H8 |
111.463 |
|
C3 |
C1 |
H9 |
111.463 |
|
C3 |
C5 |
H11 |
122.092 |
|
C4 |
C5 |
H11 |
127.548 |
|
C5 |
C4 |
H10 |
127.548 |
|
H8 |
C1 |
H9 |
107.504 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.