|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Trimethylenecycopropane)
1A' D3H
1910171554
InChI=1S/C6H6/c1-4-5(2)6(4)3/h1-3H2 INChIKey=UPWZWQGQRNPKTE-UHFFFAOYSA-N
HF/CEP-31G*
Point group is D3h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.8465 |
0.0000 |
|
-0.5133 |
0.6731 |
0.0000 |
| C2 |
0.7331 |
-0.4232 |
0.0000 |
|
0.8396 |
0.1080 |
0.0000 |
| C3 |
-0.7331 |
-0.4232 |
0.0000 |
|
-0.3263 |
-0.7811 |
0.0000 |
| C4 |
0.0000 |
2.1931 |
0.0000 |
|
-1.3298 |
1.7439 |
0.0000 |
| C5 |
1.8993 |
-1.0966 |
0.0000 |
|
2.1752 |
0.2797 |
0.0000 |
| C6 |
-1.8993 |
-1.0966 |
0.0000 |
|
-0.8454 |
-2.0236 |
0.0000 |
| H7 |
-0.9282 |
2.7481 |
0.0000 |
|
-2.4045 |
1.6224 |
0.0000 |
| H8 |
0.9282 |
2.7481 |
0.0000 |
|
-0.9282 |
2.7481 |
0.0000 |
| H9 |
2.8440 |
-0.5702 |
0.0000 |
|
2.6073 |
1.2711 |
0.0000 |
| H10 |
1.9158 |
-2.1779 |
0.0000 |
|
2.8440 |
-0.5702 |
0.0000 |
| H11 |
-1.9158 |
-2.1779 |
0.0000 |
|
-0.2028 |
-2.8935 |
0.0000 |
| H12 |
-2.8440 |
-0.5702 |
0.0000 |
|
-1.9158 |
-2.1779 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.4662 |
1.4662 |
1.3466 |
2.7171 |
2.7171 |
2.1161 |
2.1161 |
3.1774 |
3.5801 |
3.5801 |
3.1774 |
| C2 |
1.4662 |
|
1.4662 |
2.7171 |
1.3466 |
2.7171 |
3.5801 |
3.1774 |
2.1161 |
2.1161 |
3.1774 |
3.5801 |
| C3 |
1.4662 |
1.4662 |
| 2.7171 |
2.7171 |
1.3466 |
3.1774 |
3.5801 |
3.5801 |
3.1774 |
2.1161 |
2.1161 |
| C4 |
1.3466 |
2.7171 |
2.7171 |
| 3.7986 |
3.7986 |
1.0815 |
1.0815 |
3.9654 |
4.7725 |
4.7725 |
3.9654 |
| C5 |
2.7171 |
1.3466 |
2.7171 |
3.7986 |
| 3.7986 |
4.7725 |
3.9654 |
1.0815 |
1.0815 |
3.9654 |
4.7725 |
| C6 |
2.7171 |
2.7171 |
1.3466 |
3.7986 |
3.7986 |
| 3.9654 |
4.7725 |
4.7725 |
3.9654 |
1.0815 |
1.0815 |
| H7 |
2.1161 |
3.5801 |
3.1774 |
1.0815 |
4.7725 |
3.9654 |
| 1.8565 |
5.0241 |
5.6881 |
5.0241 |
3.8316 |
| H8 |
2.1161 |
3.1774 |
3.5801 |
1.0815 |
3.9654 |
4.7725 |
1.8565 |
| 3.8316 |
5.0241 |
5.6881 |
5.0241 |
| H9 |
3.1774 |
2.1161 |
3.5801 |
3.9654 |
1.0815 |
4.7725 |
5.0241 |
3.8316 |
| 1.8565 |
5.0241 |
5.6881 |
| H10 |
3.5801 |
2.1161 |
3.1774 |
4.7725 |
1.0815 |
3.9654 |
5.6881 |
5.0241 |
1.8565 |
| 3.8316 |
5.0241 |
| H11 |
3.5801 |
3.1774 |
2.1161 |
4.7725 |
3.9654 |
1.0815 |
5.0241 |
5.6881 |
5.0241 |
3.8316 |
| 1.8565 |
| H12 |
3.1774 |
3.5801 |
2.1161 |
3.9654 |
4.7725 |
1.0815 |
3.8316 |
5.0241 |
5.6881 |
5.0241 |
1.8565 |
|
Maximum atom distance is 5.6881Å
between atoms H7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
60.000 |
|
C1 |
C2 |
C5 |
150.000 |
|
C1 |
C3 |
C2 |
60.000 |
|
C1 |
C3 |
C6 |
150.000 |
|
C2 |
C1 |
C3 |
60.000 |
|
C2 |
C1 |
C4 |
150.000 |
|
C2 |
C3 |
C6 |
150.000 |
|
C3 |
C1 |
C4 |
150.000 |
|
C3 |
C2 |
C5 |
150.000 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H7 |
120.875 |
|
C1 |
C4 |
H8 |
120.875 |
|
C2 |
C5 |
H9 |
120.875 |
|
C2 |
C5 |
H10 |
120.875 |
|
C3 |
C6 |
H11 |
120.875 |
|
C3 |
C6 |
H12 |
120.875 |
|
H7 |
C4 |
H8 |
118.249 |
|
H9 |
C5 |
H10 |
118.249 |
|
H11 |
C6 |
H12 |
118.249 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.