|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
HF/CEP-31G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1907 |
|
0.0000 |
0.1907 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3955 |
|
0.0000 |
1.3955 |
0.0000 |
| C3 |
0.0000 |
1.2990 |
-0.6153 |
|
1.2990 |
-0.6153 |
-0.0000 |
| C4 |
0.0000 |
-1.2990 |
-0.6153 |
|
-1.2990 |
-0.6153 |
0.0000 |
| H5 |
-0.0006 |
2.1526 |
0.0576 |
|
2.1526 |
0.0576 |
-0.0006 |
| H6 |
0.0006 |
-2.1526 |
0.0576 |
|
-2.1526 |
0.0576 |
0.0006 |
| H7 |
0.8806 |
1.3371 |
-1.2595 |
|
1.3371 |
-1.2595 |
0.8806 |
| H8 |
-0.8799 |
1.3366 |
-1.2605 |
|
1.3366 |
-1.2605 |
-0.8799 |
| H9 |
-0.8806 |
-1.3371 |
-1.2595 |
|
-1.3371 |
-1.2595 |
-0.8806 |
| H10 |
0.8799 |
-1.3366 |
-1.2605 |
|
-1.3366 |
-1.2605 |
0.8799 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2048 |
1.5287 |
1.5287 |
2.1567 |
2.1567 |
2.1602 |
2.1603 |
2.1602 |
2.1603 |
| O2 |
1.2048 |
| 2.3939 |
2.3939 |
2.5345 |
2.5345 |
3.1004 |
3.1008 |
3.1004 |
3.1008 |
| C3 |
1.5287 |
2.3939 |
| 2.5980 |
1.0869 |
3.5166 |
1.0918 |
1.0918 |
2.8530 |
2.8525 |
| C4 |
1.5287 |
2.3939 |
2.5980 |
| 3.5166 |
1.0869 |
2.8530 |
2.8525 |
1.0918 |
1.0918 |
| H5 |
2.1567 |
2.5345 |
1.0869 |
3.5166 |
| 4.3052 |
1.7822 |
1.7823 |
3.8324 |
3.8324 |
| H6 |
2.1567 |
2.5345 |
3.5166 |
1.0869 |
4.3052 |
| 3.8324 |
3.8324 |
1.7822 |
1.7823 |
| H7 |
2.1602 |
3.1004 |
1.0918 |
2.8530 |
1.7822 |
3.8324 |
| 1.7606 |
3.2021 |
2.6737 |
| H8 |
2.1603 |
3.1008 |
1.0918 |
2.8525 |
1.7823 |
3.8324 |
1.7606 |
| 2.6737 |
3.2005 |
| H9 |
2.1602 |
3.1004 |
2.8530 |
1.0918 |
3.8324 |
1.7822 |
3.2021 |
2.6737 |
| 1.7606 |
| H10 |
2.1603 |
3.1008 |
2.8525 |
1.0918 |
3.8324 |
1.7823 |
2.6737 |
3.2005 |
1.7606 |
|
Maximum atom distance is 4.3052Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.819 |
|
O2 |
C1 |
C4 |
121.819 |
|
C3 |
C1 |
C4 |
116.363 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.933 |
|
C1 |
C3 |
H7 |
109.922 |
|
C1 |
C3 |
H8 |
109.929 |
|
C1 |
C4 |
H6 |
109.933 |
|
C1 |
C4 |
H9 |
109.922 |
|
C1 |
C4 |
H10 |
109.929 |
|
H5 |
C3 |
H7 |
109.775 |
|
H5 |
C3 |
H8 |
109.778 |
|
H6 |
C4 |
H9 |
109.775 |
|
H6 |
C4 |
H10 |
109.778 |
|
H7 |
C3 |
H8 |
107.468 |
|
H9 |
C4 |
H10 |
107.468 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.