|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H5NO2 (Nitrobenzene)
1A1 C2V
1910171554
InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H INChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N
B3LYP/CEP-31G*
Point group is not available
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| C1 |
0.0000 |
0.0000 |
0.2278 |
| C2 |
0.0000 |
1.2433 |
-0.4498 |
| C3 |
0.0000 |
1.2317 |
-1.8645 |
| C4 |
0.0000 |
0.0000 |
-2.5701 |
| C5 |
0.0000 |
-1.2317 |
-1.8645 |
| C6 |
0.0000 |
-1.2433 |
-0.4498 |
| N7 |
0.0000 |
0.0000 |
1.7142 |
| O8 |
0.0000 |
-1.1044 |
2.2966 |
| O9 |
0.0000 |
1.1044 |
2.2966 |
| H10 |
0.0000 |
2.1726 |
0.1203 |
| H11 |
0.0000 |
2.1787 |
-2.4117 |
| H12 |
0.0000 |
0.0000 |
-3.6642 |
| H13 |
0.0000 |
-2.1787 |
-2.4117 |
| H14 |
0.0000 |
-2.1726 |
0.1203 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
N7 |
O8 |
O9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.4159 |
2.4279 |
2.7978 |
2.4279 |
1.4159 |
1.4865 |
2.3452 |
2.3452 |
2.1753 |
3.4225 |
3.8920 |
3.4225 |
2.1753 |
| C2 |
1.4159 |
|
1.4148 |
2.4579 |
2.8509 |
2.4866 |
2.4957 |
3.6131 |
2.7499 |
1.0902 |
2.1735 |
3.4465 |
3.9445 |
3.4632 |
| C3 |
2.4279 |
1.4148 |
|
1.4195 |
2.4635 |
2.8509 |
3.7848 |
4.7721 |
4.1631 |
2.1965 |
1.0937 |
2.1808 |
3.4541 |
3.9407 |
| C4 |
2.7978 |
2.4579 |
1.4195 |
|
1.4195 |
2.4579 |
4.2843 |
4.9904 |
4.9904 |
3.4581 |
2.1844 |
1.0941 |
2.1844 |
3.4581 |
| C5 |
2.4279 |
2.8509 |
2.4635 |
1.4195 |
|
1.4148 |
3.7848 |
4.1631 |
4.7721 |
3.9407 |
3.4541 |
2.1808 |
1.0937 |
2.1965 |
| C6 |
1.4159 |
2.4866 |
2.8509 |
2.4579 |
1.4148 |
| 2.4957 |
2.7499 |
3.6131 |
3.4632 |
3.9445 |
3.4465 |
2.1735 |
1.0902 |
| N7 |
1.4865 |
2.4957 |
3.7848 |
4.2843 |
3.7848 |
2.4957 |
|
1.2485 |
1.2485 |
2.6946 |
4.6658 |
5.3784 |
4.6658 |
2.6946 |
| O8 |
2.3452 |
3.6131 |
4.7721 |
4.9904 |
4.1631 |
2.7499 |
1.2485 |
| 2.2088 |
3.9338 |
5.7399 |
6.0622 |
4.8293 |
2.4243 |
| O9 |
2.3452 |
2.7499 |
4.1631 |
4.9904 |
4.7721 |
3.6131 |
1.2485 |
2.2088 |
| 2.4243 |
4.8293 |
6.0622 |
5.7399 |
3.9338 |
| H10 |
2.1753 |
1.0902 |
2.1965 |
3.4581 |
3.9407 |
3.4632 |
2.6946 |
3.9338 |
2.4243 |
| 2.5320 |
4.3638 |
5.0344 |
4.3452 |
| H11 |
3.4225 |
2.1735 |
1.0937 |
2.1844 |
3.4541 |
3.9445 |
4.6658 |
5.7399 |
4.8293 |
2.5320 |
| 2.5131 |
4.3574 |
5.0344 |
| H12 |
3.8920 |
3.4465 |
2.1808 |
1.0941 |
2.1808 |
3.4465 |
5.3784 |
6.0622 |
6.0622 |
4.3638 |
2.5131 |
| 2.5131 |
4.3638 |
| H13 |
3.4225 |
3.9445 |
3.4541 |
2.1844 |
1.0937 |
2.1735 |
4.6658 |
4.8293 |
5.7399 |
5.0344 |
4.3574 |
2.5131 |
| 2.5320 |
| H14 |
2.1753 |
3.4632 |
3.9407 |
3.4581 |
2.1965 |
1.0902 |
2.6946 |
2.4243 |
3.9338 |
4.3452 |
5.0344 |
4.3638 |
2.5320 |
|
Maximum atom distance is 6.0622Å
between atoms O8 and H12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
118.119 |
|
C1 |
C6 |
C5 |
118.119 |
|
C1 |
N7 |
O8 |
117.802 |
|
C1 |
N7 |
O9 |
117.802 |
|
C2 |
C1 |
C6 |
122.825 |
|
C2 |
C1 |
N7 |
118.588 |
|
C2 |
C3 |
C4 |
120.272 |
|
C3 |
C4 |
C5 |
120.393 |
|
C4 |
C5 |
C6 |
120.272 |
|
C6 |
C1 |
N7 |
118.588 |
|
O8 |
N7 |
O9 |
124.396 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H10 |
119.886 |
|
C1 |
C6 |
H14 |
119.886 |
|
C2 |
C3 |
H11 |
119.551 |
|
C3 |
C2 |
H10 |
121.994 |
|
C3 |
C4 |
H12 |
119.803 |
|
C4 |
C3 |
H11 |
120.177 |
|
C4 |
C5 |
H13 |
120.177 |
|
C5 |
C4 |
H12 |
119.803 |
|
C5 |
C6 |
H14 |
121.994 |
|
C6 |
C5 |
H13 |
119.551 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.