|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
HF/CEP-121G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0007 |
-1.3166 |
0.0000 |
|
0.0000 |
0.0007 |
-1.3166 |
| N2 |
-0.0106 |
0.1749 |
0.0000 |
|
-0.0000 |
-0.0106 |
0.1749 |
| H3 |
1.0412 |
-1.6140 |
0.0000 |
|
0.0017 |
1.0412 |
-1.6140 |
| H4 |
-0.4915 |
-1.6495 |
0.8995 |
|
0.8987 |
-0.4929 |
-1.6495 |
| H5 |
-0.4915 |
-1.6495 |
-0.8995 |
|
-0.9003 |
-0.4900 |
-1.6495 |
| O6 |
0.0007 |
0.7243 |
-1.0689 |
|
-1.0689 |
0.0024 |
0.7243 |
| O7 |
0.0007 |
0.7243 |
1.0689 |
|
1.0689 |
-0.0010 |
0.7243 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.4915 |
1.0822 |
1.0780 |
1.0780 |
2.3038 |
2.3038 |
| N2 |
1.4915 |
| 2.0753 |
2.0902 |
2.0902 |
1.2018 |
1.2018 |
| H3 |
1.0822 |
2.0753 |
| 1.7775 |
1.7775 |
2.7736 |
2.7736 |
| H4 |
1.0780 |
2.0902 |
1.7775 |
| 1.7990 |
3.1227 |
2.4302 |
| H5 |
1.0780 |
2.0902 |
1.7775 |
1.7990 |
| 2.4302 |
3.1227 |
| O6 |
2.3038 |
1.2018 |
2.7736 |
3.1227 |
2.4302 |
| 2.1377 |
| O7 |
2.3038 |
1.2018 |
2.7736 |
2.4302 |
3.1227 |
2.1377 |
|
Maximum atom distance is 3.1227Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
117.196 |
|
C1 |
N2 |
O7 |
117.196 |
|
O6 |
N2 |
O7 |
125.585 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
106.388 |
|
N2 |
C1 |
H4 |
107.777 |
|
N2 |
C1 |
H5 |
107.777 |
|
H3 |
C1 |
H4 |
110.740 |
|
H3 |
C1 |
H5 |
110.740 |
|
H4 |
C1 |
H5 |
113.101 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.