|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H6 (1-Buten-3-yne, 2-methyl-)
1A' CS
1910171554
InChI=1S/C5H6/c1-4-5(2)3/h1H,2H2,3H3 INChIKey=BOFLDKIFLIFLJA-UHFFFAOYSA-N
B3LYP/CEP-121G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-1.5020 |
0.6720 |
0.0000 |
|
0.1500 |
-1.6387 |
0.0000 |
| H2 |
-1.7066 |
1.7484 |
0.0000 |
|
1.1024 |
-2.1804 |
0.0000 |
| H3 |
-1.9750 |
0.2236 |
0.8836 |
|
-0.4273 |
-1.9412 |
0.8836 |
| H4 |
-1.9750 |
0.2236 |
-0.8836 |
|
-0.4273 |
-1.9412 |
-0.8836 |
| C5 |
0.6971 |
-2.1578 |
0.0000 |
|
-1.8164 |
1.3575 |
0.0000 |
| H6 |
0.9690 |
-3.1907 |
0.0000 |
|
-2.7058 |
1.9490 |
0.0000 |
| C7 |
0.4046 |
-0.9777 |
0.0000 |
|
-0.7943 |
0.6991 |
0.0000 |
| C8 |
0.0000 |
0.4083 |
0.0000 |
|
0.3864 |
-0.1321 |
0.0000 |
| C9 |
0.9213 |
1.3973 |
0.0000 |
|
1.6202 |
0.4198 |
0.0000 |
| H10 |
1.9879 |
1.1840 |
0.0000 |
|
1.7633 |
1.4980 |
0.0000 |
| H11 |
0.6161 |
2.4426 |
0.0000 |
|
2.5105 |
-0.2071 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
C7 |
C8 |
C9 |
H10 |
H11 |
| C1 |
|
1.0957 |
1.0979 |
1.0979 |
3.5839 |
4.5855 |
2.5213 |
1.5250 |
2.5296 |
3.5273 |
2.7607 |
| H2 |
1.0957 |
| 1.7827 |
1.7827 |
4.5865 |
5.6173 |
3.4480 |
2.1699 |
2.6513 |
3.7373 |
2.4242 |
| H3 |
1.0979 |
1.7827 |
| 1.7671 |
3.6867 |
4.5941 |
2.8083 |
2.1715 |
3.2477 |
4.1722 |
3.5240 |
| H4 |
1.0979 |
1.7827 |
1.7671 |
| 3.6867 |
4.5941 |
2.8083 |
2.1715 |
3.2477 |
4.1722 |
3.5240 |
| C5 |
3.5839 |
4.5865 |
3.6867 |
3.6867 |
|
1.0681 |
1.2158 |
2.6591 |
3.5622 |
3.5824 |
4.6011 |
| H6 |
4.5855 |
5.6173 |
4.5941 |
4.5941 |
1.0681 |
| 2.2839 |
3.7272 |
4.5883 |
4.4918 |
5.6444 |
| C7 |
2.5213 |
3.4480 |
2.8083 |
2.8083 |
1.2158 |
2.2839 |
|
1.4438 |
2.4306 |
2.6795 |
3.4268 |
| C8 |
1.5250 |
2.1699 |
2.1715 |
2.1715 |
2.6591 |
3.7272 |
1.4438 |
|
1.3517 |
2.1338 |
2.1255 |
| C9 |
2.5296 |
2.6513 |
3.2477 |
3.2477 |
3.5622 |
4.5883 |
2.4306 |
1.3517 |
|
1.0877 |
1.0889 |
| H10 |
3.5273 |
3.7373 |
4.1722 |
4.1722 |
3.5824 |
4.4918 |
2.6795 |
2.1338 |
1.0877 |
| 1.8617 |
| H11 |
2.7607 |
2.4242 |
3.5240 |
3.5240 |
4.6011 |
5.6444 |
3.4268 |
2.1255 |
1.0889 |
1.8617 |
|
Maximum atom distance is 5.6444Å
between atoms H6 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C8 |
C7 |
116.231 |
|
C1 |
C8 |
C9 |
123.013 |
|
C5 |
C7 |
C8 |
177.645 |
|
C7 |
C8 |
C9 |
120.756 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
H3 |
108.714 |
|
H2 |
C1 |
H4 |
108.714 |
|
H2 |
C1 |
C8 |
110.716 |
|
H3 |
C1 |
H4 |
107.171 |
|
H3 |
C1 |
C8 |
110.712 |
|
H4 |
C1 |
C8 |
110.712 |
|
H6 |
C5 |
C7 |
179.169 |
|
C8 |
C9 |
H10 |
121.657 |
|
C8 |
C9 |
H11 |
120.749 |
|
H10 |
C9 |
H11 |
117.594 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.