|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CClCH2CH3 (1-Butene, 2-chloro-)
1A' CS
1910171554
InChI=1S/C4H7Cl/c1-3-4(2)5/h2-3H2,1H3 INChIKey=HSEFPJMMKNHABB-UHFFFAOYSA-N
MP2/LANL2DZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
2.2711 |
-0.9288 |
0.0000 |
|
0.1965 |
2.4458 |
0.0000 |
| H2 |
2.7120 |
-1.9415 |
0.0000 |
|
-0.5080 |
3.2964 |
0.0000 |
| H3 |
2.6342 |
-0.3965 |
0.8969 |
|
0.8355 |
2.5295 |
0.8969 |
| H4 |
2.6342 |
-0.3965 |
-0.8969 |
|
0.8355 |
2.5295 |
-0.8969 |
| C5 |
0.7150 |
-1.0404 |
0.0000 |
|
-0.6055 |
1.1077 |
0.0000 |
| H6 |
0.3791 |
-1.6082 |
-0.8885 |
|
-1.2638 |
1.0643 |
-0.8885 |
| H7 |
0.3791 |
-1.6082 |
0.8885 |
|
-1.2638 |
1.0643 |
0.8885 |
| C8 |
0.5351 |
1.5633 |
0.0000 |
|
1.6365 |
-0.2283 |
0.0000 |
| H9 |
1.6192 |
1.6958 |
0.0000 |
|
2.2441 |
0.6792 |
0.0000 |
| C10 |
0.0000 |
0.3112 |
0.0000 |
|
0.2777 |
-0.1405 |
0.0000 |
| Cl11 |
-1.8469 |
0.1390 |
0.0000 |
|
-0.7097 |
-1.7108 |
0.0000 |
| H12 |
-0.0876 |
2.4596 |
0.0000 |
|
2.1551 |
-1.1886 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
H7 |
C8 |
H9 |
C10 |
Cl11 |
H12 |
| C1 |
|
1.1044 |
1.1044 |
1.1044 |
1.5601 |
2.1979 |
2.1979 |
3.0372 |
2.7044 |
2.5876 |
4.2542 |
4.1286 |
| H2 |
1.1044 |
| 1.7882 |
1.7882 |
2.1909 |
2.5186 |
2.5186 |
4.1258 |
3.7979 |
3.5256 |
5.0112 |
5.2161 |
| H3 |
1.1044 |
1.7882 |
| 1.7937 |
2.2141 |
3.1211 |
2.5601 |
3.0085 |
2.4924 |
2.8713 |
4.6012 |
4.0460 |
| H4 |
1.1044 |
1.7882 |
1.7937 |
| 2.2141 |
2.5601 |
3.1211 |
3.0085 |
2.4924 |
2.8713 |
4.6012 |
4.0460 |
| C5 |
1.5601 |
2.1909 |
2.2141 |
2.2141 |
|
1.1067 |
1.1067 |
2.6099 |
2.8817 |
1.5290 |
2.8204 |
3.5908 |
| H6 |
2.1979 |
2.5186 |
3.1211 |
2.5601 |
1.1067 |
| 1.7771 |
3.2972 |
3.6392 |
2.1487 |
2.9660 |
4.1897 |
| H7 |
2.1979 |
2.5186 |
2.5601 |
3.1211 |
1.1067 |
1.7771 |
| 3.2972 |
3.6392 |
2.1487 |
2.9660 |
4.1897 |
| C8 |
3.0372 |
4.1258 |
3.0085 |
3.0085 |
2.6099 |
3.2972 |
3.2972 |
|
1.0922 |
1.3616 |
2.7753 |
1.0914 |
| H9 |
2.7044 |
3.7979 |
2.4924 |
2.4924 |
2.8817 |
3.6392 |
3.6392 |
1.0922 |
| 2.1305 |
3.7996 |
1.8699 |
| C10 |
2.5876 |
3.5256 |
2.8713 |
2.8713 |
1.5290 |
2.1487 |
2.1487 |
1.3616 |
2.1305 |
| 1.8549 |
2.1502 |
| Cl11 |
4.2542 |
5.0112 |
4.6012 |
4.6012 |
2.8204 |
2.9660 |
2.9660 |
2.7753 |
3.7996 |
1.8549 |
| 2.9120 |
| H12 |
4.1286 |
5.2161 |
4.0460 |
4.0460 |
3.5908 |
4.1897 |
4.1897 |
1.0914 |
1.8699 |
2.1502 |
2.9120 |
|
Maximum atom distance is 5.2161Å
between atoms H2 and H12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
C10 |
113.781 |
|
C5 |
C10 |
C8 |
128.980 |
|
C5 |
C10 |
Cl11 |
112.555 |
|
C8 |
C10 |
Cl11 |
118.465 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
H6 |
109.845 |
|
C1 |
C5 |
H7 |
109.845 |
|
H2 |
C1 |
H3 |
108.104 |
|
H2 |
C1 |
H4 |
108.104 |
|
H2 |
C1 |
C5 |
109.429 |
|
H3 |
C1 |
H4 |
108.605 |
|
H3 |
C1 |
C5 |
111.247 |
|
H4 |
C1 |
C5 |
111.247 |
|
H6 |
C5 |
H7 |
106.813 |
|
H6 |
C5 |
C10 |
108.152 |
|
H7 |
C5 |
C10 |
108.152 |
|
H9 |
C8 |
C10 |
120.109 |
|
H9 |
C8 |
H12 |
117.822 |
|
C10 |
C8 |
H12 |
122.069 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.