|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
B3LYP/LANL2DZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5637 |
0.0000 |
|
0.5539 |
-0.1049 |
0.0000 |
| C2 |
-0.5932 |
-0.8293 |
0.0000 |
|
-0.9252 |
-0.4285 |
0.0000 |
| C3 |
0.4729 |
-1.9364 |
0.0000 |
|
-1.8146 |
0.8250 |
0.0000 |
| O4 |
-1.0001 |
1.5343 |
0.0000 |
|
1.3214 |
-1.2682 |
0.0000 |
| O5 |
1.2008 |
0.8706 |
0.0000 |
|
1.0789 |
1.0178 |
0.0000 |
| H6 |
-1.2515 |
-0.9074 |
0.8761 |
|
-1.1245 |
-1.0608 |
0.8761 |
| H7 |
-1.2515 |
-0.9074 |
-0.8761 |
|
-1.1245 |
-1.0608 |
-0.8761 |
| H8 |
-0.0075 |
-2.9222 |
0.0000 |
|
-2.8726 |
0.5365 |
0.0000 |
| H9 |
1.1171 |
-1.8640 |
-0.8832 |
|
-1.6236 |
1.4445 |
-0.8832 |
| H10 |
1.1171 |
-1.8640 |
0.8832 |
|
-1.6236 |
1.4445 |
0.8832 |
| H11 |
-0.6073 |
2.4372 |
0.0000 |
|
2.2816 |
-1.0502 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5141 |
2.5445 |
1.3936 |
1.2394 |
2.1209 |
2.1209 |
3.4860 |
2.8146 |
2.8146 |
1.9695 |
| C2 |
1.5141 |
|
1.5370 |
2.3984 |
2.4715 |
1.0986 |
1.0986 |
2.1734 |
2.1854 |
2.1854 |
3.2666 |
| C3 |
2.5445 |
1.5370 |
| 3.7704 |
2.8999 |
2.1909 |
2.1909 |
1.0966 |
1.0956 |
1.0956 |
4.5051 |
| O4 |
1.3936 |
2.3984 |
3.7704 |
| 2.2988 |
2.6063 |
2.6063 |
4.5658 |
4.1002 |
4.1002 |
0.9846 |
| O5 |
1.2394 |
2.4715 |
2.8999 |
2.2988 |
| 3.1532 |
3.1532 |
3.9807 |
2.8750 |
2.8750 |
2.3923 |
| H6 |
2.1209 |
1.0986 |
2.1909 |
2.6063 |
3.1532 |
| 1.7521 |
2.5248 |
3.1017 |
2.5545 |
3.5170 |
| H7 |
2.1209 |
1.0986 |
2.1909 |
2.6063 |
3.1532 |
1.7521 |
| 2.5248 |
2.5545 |
3.1017 |
3.5170 |
| H8 |
3.4860 |
2.1734 |
1.0966 |
4.5658 |
3.9807 |
2.5248 |
2.5248 |
| 1.7790 |
1.7790 |
5.3929 |
| H9 |
2.8146 |
2.1854 |
1.0956 |
4.1002 |
2.8750 |
3.1017 |
2.5545 |
1.7790 |
| 1.7665 |
4.7174 |
| H10 |
2.8146 |
2.1854 |
1.0956 |
4.1002 |
2.8750 |
2.5545 |
3.1017 |
1.7790 |
1.7665 |
| 4.7174 |
| H11 |
1.9695 |
3.2666 |
4.5051 |
0.9846 |
2.3923 |
3.5170 |
3.5170 |
5.3929 |
4.7174 |
4.7174 |
|
Maximum atom distance is 5.3929Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
113.016 |
|
C2 |
C1 |
O4 |
111.076 |
|
C2 |
C1 |
O5 |
127.404 |
|
O4 |
C1 |
O5 |
121.520 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.469 |
|
C1 |
C2 |
H7 |
107.469 |
|
C1 |
O4 |
H11 |
110.630 |
|
C2 |
C3 |
H8 |
110.104 |
|
C2 |
C3 |
H9 |
111.113 |
|
C2 |
C3 |
H10 |
111.113 |
|
C3 |
C2 |
H6 |
111.373 |
|
C3 |
C2 |
H7 |
111.373 |
|
H6 |
C2 |
H7 |
105.767 |
|
H8 |
C3 |
H9 |
108.482 |
|
H8 |
C3 |
H10 |
108.482 |
|
H9 |
C3 |
H10 |
107.445 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.