|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
MP2/LANL2DZ
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1723 |
|
0.1723 |
-0.0002 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4450 |
|
1.4450 |
-0.0020 |
0.0000 |
| C3 |
0.0000 |
1.3126 |
-0.6316 |
|
-0.6316 |
0.0009 |
1.3126 |
| C4 |
0.0000 |
-1.3126 |
-0.6316 |
|
-0.6316 |
0.0009 |
-1.3126 |
| H5 |
0.1827 |
2.1658 |
0.0401 |
|
0.0403 |
0.1826 |
2.1658 |
| H6 |
-0.1827 |
-2.1658 |
0.0401 |
|
0.0398 |
-0.1827 |
-2.1658 |
| H7 |
0.7719 |
1.2831 |
-1.4215 |
|
-1.4204 |
0.7738 |
1.2831 |
| H8 |
-0.9809 |
1.4439 |
-1.1260 |
|
-1.1274 |
-0.9793 |
1.4439 |
| H9 |
-0.7719 |
-1.2831 |
-1.4215 |
|
-1.4226 |
-0.7699 |
-1.2831 |
| H10 |
0.9809 |
-1.4439 |
-1.1260 |
|
-1.1247 |
0.9824 |
-1.4439 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2727 |
1.5392 |
1.5392 |
2.1775 |
2.1775 |
2.1868 |
2.1755 |
2.1868 |
2.1755 |
| O2 |
1.2727 |
| 2.4567 |
2.4567 |
2.5880 |
2.5880 |
3.2340 |
3.1076 |
3.2340 |
3.1076 |
| C3 |
1.5392 |
2.4567 |
| 2.6253 |
1.1011 |
3.5474 |
1.1048 |
1.1063 |
2.8209 |
2.9674 |
| C4 |
1.5392 |
2.4567 |
2.6253 |
| 3.5474 |
1.1011 |
2.8209 |
2.9674 |
1.1048 |
1.1063 |
| H5 |
2.1775 |
2.5880 |
1.1011 |
3.5474 |
| 4.3470 |
1.8063 |
1.7985 |
3.8655 |
3.8765 |
| H6 |
2.1775 |
2.5880 |
3.5474 |
1.1011 |
4.3470 |
| 3.8655 |
3.8765 |
1.8063 |
1.7985 |
| H7 |
2.1868 |
3.2340 |
1.1048 |
2.8209 |
1.8063 |
3.8655 |
| 1.7847 |
2.9947 |
2.7509 |
| H8 |
2.1755 |
3.1076 |
1.1063 |
2.9674 |
1.7985 |
3.8765 |
1.7847 |
| 2.7509 |
3.4911 |
| H9 |
2.1868 |
3.2340 |
2.8209 |
1.1048 |
3.8655 |
1.8063 |
2.9947 |
2.7509 |
| 1.7847 |
| H10 |
2.1755 |
3.1076 |
2.9674 |
1.1063 |
3.8765 |
1.7985 |
2.7509 |
3.4911 |
1.7847 |
|
Maximum atom distance is 4.3470Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.483 |
|
O2 |
C1 |
C4 |
121.483 |
|
C3 |
C1 |
C4 |
117.034 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
110.011 |
|
C1 |
C3 |
H7 |
110.521 |
|
C1 |
C3 |
H8 |
109.549 |
|
C1 |
C4 |
H6 |
110.011 |
|
C1 |
C4 |
H9 |
110.521 |
|
C1 |
C4 |
H10 |
109.549 |
|
H5 |
C3 |
H7 |
109.938 |
|
H5 |
C3 |
H8 |
109.135 |
|
H6 |
C4 |
H9 |
109.938 |
|
H6 |
C4 |
H10 |
109.135 |
|
H7 |
C3 |
H8 |
107.641 |
|
H9 |
C4 |
H10 |
107.641 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.