|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
B3LYP/LANL2DZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6884 |
-0.1384 |
0.0000 |
|
0.3818 |
-0.5728 |
-0.1384 |
| H2 |
-1.6101 |
0.4330 |
0.0000 |
|
0.8931 |
-1.3397 |
0.4330 |
| Br3 |
0.8327 |
1.1642 |
0.0000 |
|
-0.4619 |
0.6929 |
1.1642 |
| Cl4 |
-0.6884 |
-1.1867 |
1.5212 |
|
1.6475 |
0.2710 |
-1.1867 |
| Cl5 |
-0.6884 |
-1.1867 |
-1.5212 |
|
-0.8839 |
-1.4165 |
-1.1867 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0845 |
2.0026 |
1.8474 |
1.8474 |
| H2 |
1.0845 |
| 2.5499 |
2.4056 |
2.4056 |
| Br3 |
2.0026 |
2.5499 |
| 3.1866 |
3.1866 |
| Cl4 |
1.8474 |
2.4056 |
3.1866 |
| 3.0423 |
| Cl5 |
1.8474 |
2.4056 |
3.1866 |
3.0423 |
|
Maximum atom distance is 3.1866Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.660 |
|
Br3 |
C1 |
Cl5 |
111.660 |
|
Cl4 |
C1 |
Cl5 |
110.855 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
107.629 |
|
H2 |
C1 |
Cl4 |
107.397 |
|
H2 |
C1 |
Cl5 |
107.397 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.