|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Dewar Benzene)
1A1 C2V
1910171554
InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1-6H INChIKey=CTLSARLLLBZBRV-UHFFFAOYSA-N
HF/SDD
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.7897 |
0.5302 |
|
0.0000 |
0.7897 |
0.5302 |
| C2 |
0.0000 |
-0.7897 |
0.5302 |
|
0.0000 |
-0.7897 |
0.5302 |
| H3 |
0.0000 |
1.3649 |
1.4412 |
|
0.0000 |
1.3649 |
1.4412 |
| H4 |
0.0000 |
-1.3649 |
1.4412 |
|
0.0000 |
-1.3649 |
1.4412 |
| C5 |
-1.3115 |
0.6707 |
-0.2687 |
|
-1.3115 |
0.6707 |
-0.2687 |
| C6 |
1.3115 |
0.6707 |
-0.2687 |
|
1.3115 |
0.6707 |
-0.2687 |
| C7 |
1.3115 |
-0.6707 |
-0.2687 |
|
1.3115 |
-0.6707 |
-0.2687 |
| C8 |
-1.3115 |
-0.6707 |
-0.2687 |
|
-1.3115 |
-0.6707 |
-0.2687 |
| H9 |
-1.9550 |
1.4093 |
-0.6991 |
|
-1.9550 |
1.4093 |
-0.6991 |
| H10 |
1.9550 |
1.4093 |
-0.6991 |
|
1.9550 |
1.4093 |
-0.6991 |
| H11 |
1.9550 |
-1.4093 |
-0.6991 |
|
1.9550 |
-1.4093 |
-0.6991 |
| H12 |
-1.9550 |
-1.4093 |
-0.6991 |
|
-1.9550 |
-1.4093 |
-0.6991 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
C7 |
C8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5794 |
1.0774 |
2.3393 |
1.5403 |
1.5403 |
2.1192 |
2.1192 |
2.3911 |
2.3911 |
3.1889 |
3.1889 |
| C2 |
1.5794 |
| 2.3393 |
1.0774 |
2.1192 |
2.1192 |
1.5403 |
1.5403 |
3.1889 |
3.1889 |
2.3911 |
2.3911 |
| H3 |
1.0774 |
2.3393 |
| 2.7297 |
2.2640 |
2.2640 |
2.9643 |
2.9643 |
2.8991 |
2.8991 |
4.0123 |
4.0123 |
| H4 |
2.3393 |
1.0774 |
2.7297 |
| 2.9643 |
2.9643 |
2.2640 |
2.2640 |
4.0123 |
4.0123 |
2.8991 |
2.8991 |
| C5 |
1.5403 |
2.1192 |
2.2640 |
2.9643 |
| 2.6230 |
2.9461 |
1.3414 |
1.0700 |
3.3766 |
3.8964 |
2.2194 |
| C6 |
1.5403 |
2.1192 |
2.2640 |
2.9643 |
2.6230 |
|
1.3414 |
2.9461 |
3.3766 |
1.0700 |
2.2194 |
3.8964 |
| C7 |
2.1192 |
1.5403 |
2.9643 |
2.2640 |
2.9461 |
1.3414 |
| 2.6230 |
3.8964 |
2.2194 |
1.0700 |
3.3766 |
| C8 |
2.1192 |
1.5403 |
2.9643 |
2.2640 |
1.3414 |
2.9461 |
2.6230 |
| 2.2194 |
3.8964 |
3.3766 |
1.0700 |
| H9 |
2.3911 |
3.1889 |
2.8991 |
4.0123 |
1.0700 |
3.3766 |
3.8964 |
2.2194 |
| 3.9101 |
4.8200 |
2.8186 |
| H10 |
2.3911 |
3.1889 |
2.8991 |
4.0123 |
3.3766 |
1.0700 |
2.2194 |
3.8964 |
3.9101 |
| 2.8186 |
4.8200 |
| H11 |
3.1889 |
2.3911 |
4.0123 |
2.8991 |
3.8964 |
2.2194 |
1.0700 |
3.3766 |
4.8200 |
2.8186 |
| 3.9101 |
| H12 |
3.1889 |
2.3911 |
4.0123 |
2.8991 |
2.2194 |
3.8964 |
3.3766 |
1.0700 |
2.8186 |
4.8200 |
3.9101 |
|
Maximum atom distance is 4.8200Å
between atoms H9 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
122.266 |
|
C2 |
C1 |
C3 |
122.266 |
|
C2 |
C1 |
C5 |
85.568 |
|
C2 |
C1 |
C6 |
85.568 |
|
C3 |
C1 |
C5 |
118.673 |
|
C3 |
C1 |
C6 |
118.673 |
|
C5 |
C1 |
C6 |
116.748 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
85.568 |
|
C1 |
C2 |
H8 |
85.568 |
|
C1 |
C5 |
H8 |
94.432 |
|
C1 |
C5 |
H9 |
131.866 |
|
C1 |
C6 |
H7 |
94.432 |
|
C1 |
C6 |
H10 |
131.866 |
|
C2 |
H7 |
C6 |
94.432 |
|
C2 |
H7 |
H11 |
131.866 |
|
C2 |
H8 |
C5 |
94.432 |
|
C2 |
H8 |
H12 |
131.866 |
|
C4 |
C2 |
H7 |
118.673 |
|
C4 |
C2 |
H8 |
118.673 |
|
C5 |
H8 |
H12 |
133.652 |
|
C6 |
H7 |
H11 |
133.652 |
|
H7 |
C6 |
H10 |
133.652 |
|
H8 |
C5 |
H9 |
133.652 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.