|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHF2 (Ethane, 1,1-difluoro-)
1A' CS
1910171554
InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3 INChIKey=NPNPZTNLOVBDOC-UHFFFAOYSA-N
MP2=FULL/aug-cc-pVDZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.3235 |
0.1745 |
0.0000 |
|
-0.0484 |
0.0000 |
0.3644 |
| C2 |
-0.9056 |
1.0417 |
0.0000 |
|
1.3748 |
0.0000 |
-0.1225 |
| H3 |
1.2783 |
0.7183 |
0.0000 |
|
-0.1680 |
0.0000 |
1.4567 |
| F4 |
0.3235 |
-0.6540 |
1.1099 |
|
-0.7194 |
1.1099 |
-0.1215 |
| F5 |
0.3235 |
-0.6540 |
-1.1099 |
|
-0.7194 |
-1.1099 |
-0.1215 |
| H6 |
-1.7983 |
0.4027 |
0.0000 |
|
1.3809 |
0.0000 |
-1.2203 |
| H7 |
-0.9059 |
1.6767 |
0.8959 |
|
1.8894 |
0.8959 |
0.2496 |
| H8 |
-0.9059 |
1.6767 |
-0.8959 |
|
1.8894 |
-0.8959 |
0.2496 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.5042 |
1.0988 |
1.3850 |
1.3850 |
2.1340 |
2.1380 |
2.1380 |
| C2 |
1.5042 |
| 2.2077 |
2.3702 |
2.3702 |
1.0978 |
1.0982 |
1.0982 |
| H3 |
1.0988 |
2.2077 |
| 2.0066 |
2.0066 |
3.0927 |
2.5480 |
2.5480 |
| F4 |
1.3850 |
2.3702 |
2.0066 |
| 2.2197 |
2.6173 |
2.6437 |
3.3116 |
| F5 |
1.3850 |
2.3702 |
2.0066 |
2.2197 |
| 2.6173 |
3.3116 |
2.6437 |
| H6 |
2.1340 |
1.0978 |
3.0927 |
2.6173 |
2.6173 |
| 1.7950 |
1.7950 |
| H7 |
2.1380 |
1.0982 |
2.5480 |
2.6437 |
3.3116 |
1.7950 |
| 1.7918 |
| H8 |
2.1380 |
1.0982 |
2.5480 |
3.3116 |
2.6437 |
1.7950 |
1.7918 |
|
Maximum atom distance is 3.3116Å
between atoms F4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
F4 |
110.172 |
|
C2 |
C1 |
F5 |
110.172 |
|
F4 |
C1 |
F5 |
106.521 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
109.203 |
|
C1 |
C2 |
H7 |
109.491 |
|
C1 |
C2 |
H8 |
109.491 |
|
C2 |
C1 |
H3 |
115.132 |
|
H3 |
C1 |
F4 |
107.220 |
|
H3 |
C1 |
F5 |
107.220 |
|
H6 |
C2 |
H7 |
109.650 |
|
H6 |
C2 |
H8 |
109.650 |
|
H7 |
C2 |
H8 |
109.342 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.