|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH(NH2)CH3 (2-Propanamine)
1A' CS
1910171554
InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3 INChIKey=JJWLVOIRVHMVIS-UHFFFAOYSA-N
B3LYP/aug-cc-pVDZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.3619 |
0.0000 |
|
-0.3617 |
-0.0140 |
0.0000 |
| N2 |
-1.3960 |
-0.1081 |
0.0000 |
|
0.1080 |
0.0042 |
-1.3960 |
| H3 |
0.0619 |
1.4686 |
0.0000 |
|
-1.4675 |
-0.0569 |
0.0619 |
| C4 |
0.6919 |
-0.1439 |
1.2668 |
|
0.1929 |
-1.2603 |
0.6919 |
| C5 |
0.6919 |
-0.1439 |
-1.2668 |
|
0.0947 |
1.2715 |
0.6919 |
| H6 |
-1.8947 |
0.2383 |
-0.8168 |
|
-0.2697 |
0.8070 |
-1.8947 |
| H7 |
-1.8947 |
0.2383 |
0.8168 |
|
-0.2064 |
-0.8254 |
-1.8947 |
| H8 |
0.6762 |
-1.2426 |
1.2972 |
|
1.2919 |
-1.2481 |
0.6762 |
| H9 |
0.6762 |
-1.2426 |
-1.2972 |
|
1.1914 |
1.3444 |
0.6762 |
| H10 |
1.7362 |
0.1965 |
1.3038 |
|
-0.1458 |
-1.3104 |
1.7362 |
| H11 |
1.7362 |
0.1965 |
-1.3038 |
|
-0.2468 |
1.2952 |
1.7362 |
| H12 |
0.1859 |
0.2293 |
2.1697 |
|
-0.1451 |
-2.1769 |
0.1859 |
| H13 |
0.1859 |
0.2293 |
-2.1697 |
|
-0.3132 |
2.1592 |
0.1859 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| C1 |
|
1.4730 |
1.1084 |
1.5295 |
1.5295 |
2.0669 |
2.0669 |
2.1713 |
2.1713 |
2.1775 |
2.1775 |
2.1817 |
2.1817 |
| N2 |
1.4730 |
| 2.1474 |
2.4424 |
2.4424 |
1.0177 |
1.0177 |
2.6951 |
2.6951 |
3.4064 |
3.4064 |
2.7063 |
2.7063 |
| H3 |
1.1084 |
2.1474 |
| 2.1452 |
2.1452 |
2.4513 |
2.4513 |
3.0677 |
3.0677 |
2.4742 |
2.4742 |
2.5017 |
2.5017 |
| C4 |
1.5295 |
2.4424 |
2.1452 |
| 2.5337 |
3.3433 |
2.6531 |
1.0992 |
2.7896 |
1.0990 |
2.7955 |
1.1002 |
3.4935 |
| C5 |
1.5295 |
2.4424 |
2.1452 |
2.5337 |
| 2.6531 |
3.3433 |
2.7896 |
1.0992 |
2.7955 |
1.0990 |
3.4935 |
1.1002 |
| H6 |
2.0669 |
1.0177 |
2.4513 |
3.3433 |
2.6531 |
| 1.6336 |
3.6430 |
3.0055 |
4.2050 |
3.6636 |
3.6398 |
2.4818 |
| H7 |
2.0669 |
1.0177 |
2.4513 |
2.6531 |
3.3433 |
1.6336 |
| 3.0055 |
3.6430 |
3.6636 |
4.2050 |
2.4818 |
3.6398 |
| H8 |
2.1713 |
2.6951 |
3.0677 |
1.0992 |
2.7896 |
3.6430 |
3.0055 |
| 2.5945 |
1.7873 |
3.1559 |
1.7799 |
3.7982 |
| H9 |
2.1713 |
2.6951 |
3.0677 |
2.7896 |
1.0992 |
3.0055 |
3.6430 |
2.5945 |
| 3.1559 |
1.7873 |
3.7982 |
1.7799 |
| H10 |
2.1775 |
3.4064 |
2.4742 |
1.0990 |
2.7955 |
4.2050 |
3.6636 |
1.7873 |
3.1559 |
| 2.6076 |
1.7760 |
3.8039 |
| H11 |
2.1775 |
3.4064 |
2.4742 |
2.7955 |
1.0990 |
3.6636 |
4.2050 |
3.1559 |
1.7873 |
2.6076 |
| 3.8039 |
1.7760 |
| H12 |
2.1817 |
2.7063 |
2.5017 |
1.1002 |
3.4935 |
3.6398 |
2.4818 |
1.7799 |
3.7982 |
1.7760 |
3.8039 |
| 4.3394 |
| H13 |
2.1817 |
2.7063 |
2.5017 |
3.4935 |
1.1002 |
2.4818 |
3.6398 |
3.7982 |
1.7799 |
3.8039 |
1.7760 |
4.3394 |
|
Maximum atom distance is 4.3394Å
between atoms H12 and H13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
C4 |
108.856 |
|
N2 |
C1 |
C5 |
108.856 |
|
C4 |
C1 |
C5 |
111.838 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
H6 |
110.839 |
|
C1 |
N2 |
H7 |
110.839 |
|
C1 |
C4 |
H8 |
110.303 |
|
C1 |
C4 |
H10 |
110.811 |
|
C1 |
C4 |
H12 |
111.066 |
|
C1 |
C5 |
H9 |
110.303 |
|
C1 |
C5 |
H11 |
110.811 |
|
C1 |
C5 |
H13 |
111.066 |
|
N2 |
C1 |
H3 |
111.807 |
|
H3 |
C1 |
C4 |
107.756 |
|
H3 |
C1 |
C5 |
107.756 |
|
H6 |
N2 |
H7 |
106.755 |
|
H8 |
C4 |
H10 |
108.798 |
|
H8 |
C4 |
H12 |
108.048 |
|
H9 |
C5 |
H11 |
108.798 |
|
H9 |
C5 |
H13 |
108.048 |
|
H10 |
C4 |
H12 |
107.716 |
|
H11 |
C5 |
H13 |
107.716 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.