|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
CCSD(T)=FULL/aug-cc-pVDZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0008 |
-1.3306 |
0.0000 |
|
0.0000 |
0.0008 |
-1.3306 |
| N2 |
-0.0104 |
0.1712 |
0.0000 |
|
-0.0000 |
-0.0103 |
0.1712 |
| H3 |
1.0582 |
-1.6363 |
0.0000 |
|
0.0018 |
1.0582 |
-1.6363 |
| H4 |
-0.5015 |
-1.6676 |
0.9156 |
|
0.9147 |
-0.5031 |
-1.6676 |
| H5 |
-0.5015 |
-1.6676 |
-0.9156 |
|
-0.9164 |
-0.4999 |
-1.6676 |
| O6 |
0.0008 |
0.7348 |
-1.0984 |
|
-1.0984 |
0.0027 |
0.7348 |
| O7 |
0.0008 |
0.7348 |
1.0984 |
|
1.0984 |
-0.0011 |
0.7348 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.5019 |
1.1007 |
1.0973 |
1.0973 |
2.3393 |
2.3393 |
| N2 |
1.5019 |
| 2.0998 |
2.1121 |
2.1121 |
1.2346 |
1.2346 |
| H3 |
1.1007 |
2.0998 |
| 1.8089 |
1.8089 |
2.8190 |
2.8190 |
| H4 |
1.0973 |
2.1121 |
1.8089 |
| 1.8311 |
3.1749 |
2.4611 |
| H5 |
1.0973 |
2.1121 |
1.8089 |
1.8311 |
| 2.4611 |
3.1749 |
| O6 |
2.3393 |
1.2346 |
2.8190 |
3.1749 |
2.4611 |
| 2.1969 |
| O7 |
2.3393 |
1.2346 |
2.8190 |
2.4611 |
3.1749 |
2.1969 |
|
Maximum atom distance is 3.1749Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
117.154 |
|
C1 |
N2 |
O7 |
117.154 |
|
O6 |
N2 |
O7 |
125.671 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
106.548 |
|
N2 |
C1 |
H4 |
107.678 |
|
N2 |
C1 |
H5 |
107.678 |
|
H3 |
C1 |
H4 |
110.761 |
|
H3 |
C1 |
H5 |
110.761 |
|
H4 |
C1 |
H5 |
113.100 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.