|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF3 (Methane, trifluoro-)
1A1 C3V
1910171554
InChI=1S/CHF3/c2-1(3)4/h1H INChIKey=XPDWGBQVDMORPB-UHFFFAOYSA-N
CCSD(T)=FULL/aug-cc-pVDZ
Point group is C3v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.3462 |
|
0.0000 |
0.0000 |
0.3462 |
| H2 |
0.0000 |
0.0000 |
1.4450 |
|
0.0000 |
0.0000 |
1.4450 |
| F3 |
0.0000 |
1.2657 |
-0.1305 |
|
-0.3658 |
1.2116 |
-0.1305 |
| F4 |
1.0961 |
-0.6328 |
-0.1305 |
|
1.2322 |
-0.2890 |
-0.1305 |
| F5 |
-1.0961 |
-0.6328 |
-0.1305 |
|
-0.8664 |
-0.9226 |
-0.1305 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
F4 |
F5 |
| C1 |
|
1.0988 |
1.3525 |
1.3525 |
1.3525 |
| H2 |
1.0988 |
| 2.0209 |
2.0209 |
2.0209 |
| F3 |
1.3525 |
2.0209 |
| 2.1922 |
2.1922 |
| F4 |
1.3525 |
2.0209 |
2.1922 |
| 2.1922 |
| F5 |
1.3525 |
2.0209 |
2.1922 |
2.1922 |
|
Maximum atom distance is 2.1922Å
between atoms F4 and F5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
F4 |
108.280 |
|
F3 |
C1 |
F5 |
108.280 |
|
F4 |
C1 |
F5 |
108.280 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.637 |
|
H2 |
C1 |
F4 |
110.637 |
|
H2 |
C1 |
F5 |
110.637 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.