|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for HO2CCHNH2CH2OH (Serine)
1A C1
1910171554
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 INChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
QCISD/aug-cc-pVDZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.8018 |
-0.5338 |
0.0184 |
|
-0.8007 |
-0.5355 |
-0.0194 |
| O2 |
2.0765 |
-0.3300 |
-0.3925 |
|
-2.0724 |
-0.3406 |
0.4047 |
| O3 |
0.4401 |
-1.5517 |
0.5807 |
|
-0.4412 |
-1.5444 |
-0.5991 |
| C4 |
-0.0948 |
0.6707 |
-0.3091 |
|
0.0957 |
0.6665 |
0.3178 |
| C5 |
-1.5275 |
0.4237 |
0.1921 |
|
1.5249 |
0.4301 |
-0.1985 |
| O6 |
-2.1276 |
-0.7167 |
-0.4009 |
|
2.1325 |
-0.7171 |
0.3734 |
| N7 |
0.4072 |
1.9381 |
0.2331 |
|
-0.4136 |
1.9402 |
-0.2023 |
| H8 |
2.5872 |
-1.1214 |
-0.1650 |
|
-2.5831 |
-1.1300 |
0.1701 |
| H9 |
-0.1272 |
0.7533 |
-1.4103 |
|
0.1369 |
0.7336 |
1.4198 |
| H10 |
-1.5195 |
0.3556 |
1.2989 |
|
1.5081 |
0.3777 |
-1.3060 |
| H11 |
-2.1343 |
1.2985 |
-0.0882 |
|
2.1319 |
1.3023 |
0.0893 |
| H12 |
-1.6802 |
-1.4967 |
-0.0504 |
|
1.6840 |
-1.4931 |
0.0155 |
| H13 |
1.3105 |
2.1819 |
-0.1683 |
|
-1.3142 |
2.1761 |
0.2098 |
| H14 |
0.5242 |
1.8858 |
1.2453 |
|
-0.5388 |
1.9020 |
-1.2141 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
O3 |
C4 |
C5 |
O6 |
N7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.3547 |
1.2179 |
1.5369 |
2.5244 |
2.9649 |
2.5124 |
1.8885 |
2.1356 |
2.7963 |
3.4626 |
2.6631 |
2.7693 |
2.7271 |
| O2 |
1.3547 |
| 2.2622 |
2.3922 |
3.7280 |
4.2218 |
2.8848 |
0.9690 |
2.6581 |
4.0326 |
4.5250 |
3.9485 |
2.6357 |
3.1625 |
| O3 |
1.2179 |
2.2622 |
| 2.4530 |
2.8151 |
2.8730 |
3.5073 |
2.3133 |
3.0983 |
2.8274 |
3.8986 |
2.2129 |
3.9062 |
3.5022 |
| C4 |
1.5369 |
2.3922 |
2.4530 |
|
1.5378 |
2.4629 |
1.4671 |
3.2289 |
1.1048 |
2.1714 |
2.1453 |
2.6978 |
2.0684 |
2.0678 |
| C5 |
2.5244 |
3.7280 |
2.8151 |
1.5378 |
|
1.4186 |
2.4573 |
4.4097 |
2.1534 |
1.1089 |
1.1010 |
1.9416 |
3.3579 |
2.7307 |
| O6 |
2.9649 |
4.2218 |
2.8730 |
2.4629 |
1.4186 |
| 3.7250 |
4.7380 |
2.6799 |
2.0998 |
2.0393 |
0.9651 |
4.5030 |
4.0639 |
| N7 |
2.5124 |
2.8848 |
3.5073 |
1.4671 |
2.4573 |
3.7250 |
| 3.7778 |
2.0953 |
2.7116 |
2.6404 |
4.0293 |
1.0181 |
1.0203 |
| H8 |
1.8885 |
0.9690 |
2.3133 |
3.2289 |
4.4097 |
4.7380 |
3.7778 |
| 3.5260 |
4.6032 |
5.3061 |
4.2854 |
3.5414 |
3.9100 |
| H9 |
2.1356 |
2.6581 |
3.0983 |
1.1048 |
2.1534 |
2.6799 |
2.0953 |
3.5260 |
| 3.0719 |
2.4645 |
3.0535 |
2.3771 |
2.9596 |
| H10 |
2.7963 |
4.0326 |
2.8274 |
2.1714 |
1.1089 |
2.0998 |
2.7116 |
4.6032 |
3.0719 |
| 1.7863 |
2.2972 |
3.6739 |
2.5537 |
| H11 |
3.4626 |
4.5250 |
3.8986 |
2.1453 |
1.1010 |
2.0393 |
2.6404 |
5.3061 |
2.4645 |
1.7863 |
| 2.8320 |
3.5572 |
3.0317 |
| H12 |
2.6631 |
3.9485 |
2.2129 |
2.6978 |
1.9416 |
0.9651 |
4.0293 |
4.2854 |
3.0535 |
2.2972 |
2.8320 |
| 4.7424 |
4.2402 |
| H13 |
2.7693 |
2.6357 |
3.9062 |
2.0684 |
3.3579 |
4.5030 |
1.0181 |
3.5414 |
2.3771 |
3.6739 |
3.5572 |
4.7424 |
| 1.6444 |
| H14 |
2.7271 |
3.1625 |
3.5022 |
2.0678 |
2.7307 |
4.0639 |
1.0203 |
3.9100 |
2.9596 |
2.5537 |
3.0317 |
4.2402 |
1.6444 |
|
Maximum atom distance is 5.3061Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
C5 |
110.374 |
|
C1 |
C4 |
N7 |
113.499 |
|
O2 |
C1 |
O3 |
123.041 |
|
O2 |
C1 |
C4 |
111.492 |
|
O3 |
C1 |
C4 |
125.466 |
|
C4 |
C5 |
O6 |
112.772 |
|
C5 |
C4 |
N7 |
109.703 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O2 |
H8 |
107.569 |
|
C1 |
C4 |
H9 |
106.740 |
|
C4 |
C5 |
H10 |
109.177 |
|
C4 |
C5 |
H11 |
107.632 |
|
C4 |
N7 |
H13 |
111.393 |
|
C4 |
N7 |
H14 |
111.197 |
|
C5 |
C4 |
H9 |
108.034 |
|
C5 |
O6 |
H12 |
107.560 |
|
O6 |
C5 |
H10 |
111.772 |
|
O6 |
C5 |
H11 |
107.406 |
|
N7 |
C4 |
H9 |
108.291 |
|
H10 |
C5 |
H11 |
107.867 |
|
H13 |
N7 |
H14 |
107.554 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.