|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
MP2=FULL/aug-cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5637 |
0.0000 |
|
0.5534 |
0.1070 |
0.0000 |
| C2 |
-0.5991 |
-0.8057 |
0.0000 |
|
-0.6773 |
-0.7412 |
0.0000 |
| C3 |
0.4470 |
-1.8970 |
0.0000 |
|
-1.9473 |
0.0788 |
0.0000 |
| O4 |
-0.9573 |
1.5185 |
0.0000 |
|
1.6726 |
-0.6516 |
0.0000 |
| O5 |
1.1779 |
0.8231 |
0.0000 |
|
0.5846 |
1.3127 |
0.0000 |
| H6 |
-1.2513 |
-0.8749 |
0.8693 |
|
-0.6215 |
-1.3946 |
0.8693 |
| H7 |
-1.2513 |
-0.8749 |
-0.8693 |
|
-0.6215 |
-1.3946 |
-0.8693 |
| H8 |
-0.0270 |
-2.8742 |
0.0000 |
|
-2.8169 |
-0.5721 |
0.0000 |
| H9 |
1.0833 |
-1.8201 |
-0.8762 |
|
-1.9926 |
0.7182 |
-0.8762 |
| H10 |
1.0833 |
-1.8201 |
0.8762 |
|
-1.9926 |
0.7182 |
0.8762 |
| H11 |
-0.4892 |
2.3651 |
0.0000 |
|
2.4149 |
-0.0314 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.4947 |
2.5009 |
1.3521 |
1.2061 |
2.0955 |
2.0955 |
3.4380 |
2.7611 |
2.7611 |
1.8666 |
| C2 |
1.4947 |
|
1.5117 |
2.3517 |
2.4106 |
1.0889 |
1.0889 |
2.1462 |
2.1512 |
2.1512 |
3.1727 |
| C3 |
2.5009 |
1.5117 |
| 3.6929 |
2.8166 |
2.1644 |
2.1644 |
1.0862 |
1.0856 |
1.0856 |
4.3637 |
| O4 |
1.3521 |
2.3517 |
3.6929 |
| 2.2455 |
2.5633 |
2.5633 |
4.4902 |
4.0097 |
4.0097 |
0.9673 |
| O5 |
1.2061 |
2.4106 |
2.8166 |
2.2455 |
| 3.0887 |
3.0887 |
3.8888 |
2.7863 |
2.7863 |
2.2708 |
| H6 |
2.0955 |
1.0889 |
2.1644 |
2.5633 |
3.0887 |
| 1.7386 |
2.5003 |
3.0644 |
2.5187 |
3.4401 |
| H7 |
2.0955 |
1.0889 |
2.1644 |
2.5633 |
3.0887 |
1.7386 |
| 2.5003 |
2.5187 |
3.0644 |
3.4401 |
| H8 |
3.4380 |
2.1462 |
1.0862 |
4.4902 |
3.8888 |
2.5003 |
2.5003 |
| 1.7641 |
1.7641 |
5.2597 |
| H9 |
2.7611 |
2.1512 |
1.0856 |
4.0097 |
2.7863 |
3.0644 |
2.5187 |
1.7641 |
| 1.7525 |
4.5559 |
| H10 |
2.7611 |
2.1512 |
1.0856 |
4.0097 |
2.7863 |
2.5187 |
3.0644 |
1.7641 |
1.7525 |
| 4.5559 |
| H11 |
1.8666 |
3.1727 |
4.3637 |
0.9673 |
2.2708 |
3.4401 |
3.4401 |
5.2597 |
4.5559 |
4.5559 |
|
Maximum atom distance is 5.2597Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
112.578 |
|
C2 |
C1 |
O4 |
111.297 |
|
C2 |
C1 |
O5 |
126.054 |
|
O4 |
C1 |
O5 |
122.649 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.354 |
|
C1 |
C2 |
H7 |
107.354 |
|
C1 |
O4 |
H11 |
105.989 |
|
C2 |
C3 |
H8 |
110.331 |
|
C2 |
C3 |
H9 |
110.762 |
|
C2 |
C3 |
H10 |
110.762 |
|
C3 |
C2 |
H6 |
111.629 |
|
C3 |
C2 |
H7 |
111.629 |
|
H6 |
C2 |
H7 |
105.934 |
|
H8 |
C3 |
H9 |
108.635 |
|
H8 |
C3 |
H10 |
108.635 |
|
H9 |
C3 |
H10 |
107.630 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.