|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
PBEPBEultrafine/aug-cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0001 |
-1.3303 |
0.0000 |
|
0.0000 |
0.0001 |
-1.3303 |
| N2 |
-0.0099 |
0.1743 |
0.0000 |
|
-0.0000 |
-0.0099 |
0.1743 |
| H3 |
1.0536 |
-1.6339 |
0.0000 |
|
0.0021 |
1.0536 |
-1.6339 |
| H4 |
-0.4936 |
-1.6752 |
0.9114 |
|
0.9104 |
-0.4955 |
-1.6752 |
| H5 |
-0.4936 |
-1.6752 |
-0.9114 |
|
-0.9124 |
-0.4918 |
-1.6752 |
| O6 |
0.0001 |
0.7341 |
-1.0955 |
|
-1.0955 |
0.0024 |
0.7341 |
| O7 |
0.0001 |
0.7341 |
1.0955 |
|
1.0955 |
-0.0021 |
0.7341 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.5046 |
1.0964 |
1.0924 |
1.0924 |
2.3370 |
2.3370 |
| N2 |
1.5046 |
| 2.0978 |
2.1179 |
2.1179 |
1.2303 |
1.2303 |
| H3 |
1.0964 |
2.0978 |
| 1.7962 |
1.7962 |
2.8138 |
2.8138 |
| H4 |
1.0924 |
2.1179 |
1.7962 |
| 1.8228 |
3.1743 |
2.4662 |
| H5 |
1.0924 |
2.1179 |
1.7962 |
1.8228 |
| 2.4662 |
3.1743 |
| O6 |
2.3370 |
1.2303 |
2.8138 |
3.1743 |
2.4662 |
| 2.1910 |
| O7 |
2.3370 |
1.2303 |
2.8138 |
2.4662 |
3.1743 |
2.1910 |
|
Maximum atom distance is 3.1743Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
117.061 |
|
C1 |
N2 |
O7 |
117.061 |
|
O6 |
N2 |
O7 |
125.860 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
106.462 |
|
N2 |
C1 |
H4 |
108.222 |
|
N2 |
C1 |
H5 |
108.222 |
|
H3 |
C1 |
H4 |
110.295 |
|
H3 |
C1 |
H5 |
110.295 |
|
H4 |
C1 |
H5 |
113.083 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.