|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3SOCH3 (Dimethyl sulfoxide)
1A' CS
1910171554
InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 INChIKey=IAZDPXIOMUYVGZ-UHFFFAOYSA-N
B97D3/aug-cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| S1 |
0.2602 |
0.4355 |
0.0000 |
|
0.0000 |
0.2287 |
0.4528 |
| O2 |
-1.1038 |
1.0844 |
0.0000 |
|
0.0000 |
1.5066 |
-0.3525 |
| C3 |
0.2602 |
-0.7965 |
1.3666 |
|
1.3666 |
-0.8122 |
-0.2062 |
| C4 |
0.2602 |
-0.7965 |
-1.3666 |
|
-1.3666 |
-0.8122 |
-0.2062 |
| H5 |
1.1822 |
-1.3829 |
1.3279 |
|
1.3279 |
-1.8008 |
0.2590 |
| H6 |
1.1822 |
-1.3829 |
-1.3279 |
|
-1.3279 |
-1.8008 |
0.2590 |
| H7 |
0.2122 |
-0.2271 |
2.2962 |
|
2.2962 |
-0.3054 |
0.0578 |
| H8 |
0.2122 |
-0.2271 |
-2.2962 |
|
-2.2962 |
-0.3054 |
0.0578 |
| H9 |
-0.6226 |
-1.4321 |
1.2633 |
|
1.2633 |
-0.8769 |
-1.2921 |
| H10 |
-0.6226 |
-1.4321 |
-1.2633 |
|
-1.2633 |
-0.8769 |
-1.2921 |
Atom - Atom Distances (Å)
| |
S1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| S1 |
| 1.5105 |
1.8400 |
1.8400 |
2.4331 |
2.4331 |
2.3904 |
2.3904 |
2.4214 |
2.4214 |
| O2 |
1.5105 |
| 2.6955 |
2.6955 |
3.6162 |
3.6162 |
2.9537 |
2.9537 |
2.8566 |
2.8566 |
| C3 |
1.8400 |
2.6955 |
| 2.7331 |
1.0933 |
2.9076 |
1.0912 |
3.7071 |
1.0927 |
2.8460 |
| C4 |
1.8400 |
2.6955 |
2.7331 |
| 2.9076 |
1.0933 |
3.7071 |
1.0912 |
2.8460 |
1.0927 |
| H5 |
2.4331 |
3.6162 |
1.0933 |
2.9076 |
| 2.6559 |
1.7929 |
3.9257 |
1.8066 |
3.1582 |
| H6 |
2.4331 |
3.6162 |
2.9076 |
1.0933 |
2.6559 |
| 3.9257 |
1.7929 |
3.1582 |
1.8066 |
| H7 |
2.3904 |
2.9537 |
1.0912 |
3.7071 |
1.7929 |
3.9257 |
| 4.5924 |
1.7932 |
3.8495 |
| H8 |
2.3904 |
2.9537 |
3.7071 |
1.0912 |
3.9257 |
1.7929 |
4.5924 |
| 3.8495 |
1.7932 |
| H9 |
2.4214 |
2.8566 |
1.0927 |
2.8460 |
1.8066 |
3.1582 |
1.7932 |
3.8495 |
| 2.5266 |
| H10 |
2.4214 |
2.8566 |
2.8460 |
1.0927 |
3.1582 |
1.8066 |
3.8495 |
1.7932 |
2.5266 |
|
Maximum atom distance is 4.5924Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
S1 |
C3 |
106.717 |
|
O2 |
S1 |
C4 |
106.717 |
|
C3 |
S1 |
C4 |
95.928 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S1 |
C3 |
H5 |
109.445 |
|
S1 |
C3 |
H7 |
106.458 |
|
S1 |
C3 |
H9 |
108.619 |
|
S1 |
C4 |
H6 |
109.445 |
|
S1 |
C4 |
H8 |
106.458 |
|
S1 |
C4 |
H10 |
108.619 |
|
H5 |
C3 |
H7 |
110.313 |
|
H5 |
C3 |
H9 |
111.467 |
|
H6 |
C4 |
H8 |
110.313 |
|
H6 |
C4 |
H10 |
111.467 |
|
H7 |
C3 |
H9 |
110.393 |
|
H8 |
C4 |
H10 |
110.393 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.