|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CSCH3 (Thioacetone)
1A1 C2V
1910171554
InChI=1S/C3H6S/c1-3(2)4/h1-2H3 INChIKey=JTNXQVCPQMQLHK-UHFFFAOYSA-N
wB97X-D/aug-cc-pVTZ
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
-0.2499 |
|
-0.2499 |
0.0000 |
0.0000 |
| S2 |
0.0000 |
0.0000 |
1.3713 |
|
1.3713 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2614 |
-1.0610 |
|
-1.0610 |
1.2614 |
0.0000 |
| C4 |
0.0000 |
-1.2614 |
-1.0610 |
|
-1.0610 |
-1.2614 |
0.0000 |
| H5 |
0.0000 |
2.1442 |
-0.4291 |
|
-0.4291 |
2.1442 |
0.0000 |
| H6 |
0.0000 |
-2.1442 |
-0.4291 |
|
-0.4291 |
-2.1442 |
0.0000 |
| H7 |
0.8768 |
1.2780 |
-1.7128 |
|
-1.7128 |
1.2780 |
0.8768 |
| H8 |
-0.8768 |
1.2780 |
-1.7128 |
|
-1.7128 |
1.2780 |
-0.8768 |
| H9 |
-0.8768 |
-1.2780 |
-1.7128 |
|
-1.7128 |
-1.2780 |
-0.8768 |
| H10 |
0.8768 |
-1.2780 |
-1.7128 |
|
-1.7128 |
-1.2780 |
0.8768 |
Atom - Atom Distances (Å)
| |
C1 |
S2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
| 1.6212 |
1.4997 |
1.4997 |
2.1517 |
2.1517 |
2.1312 |
2.1312 |
2.1312 |
2.1312 |
| S2 |
1.6212 |
| 2.7399 |
2.7399 |
2.7998 |
2.7998 |
3.4516 |
3.4516 |
3.4516 |
3.4516 |
| C3 |
1.4997 |
2.7399 |
| 2.5228 |
1.0857 |
3.4637 |
1.0927 |
1.0927 |
2.7644 |
2.7644 |
| C4 |
1.4997 |
2.7399 |
2.5228 |
| 3.4637 |
1.0857 |
2.7644 |
2.7644 |
1.0927 |
1.0927 |
| H5 |
2.1517 |
2.7998 |
1.0857 |
3.4637 |
| 4.2884 |
1.7796 |
1.7796 |
3.7587 |
3.7587 |
| H6 |
2.1517 |
2.7998 |
3.4637 |
1.0857 |
4.2884 |
| 3.7587 |
3.7587 |
1.7796 |
1.7796 |
| H7 |
2.1312 |
3.4516 |
1.0927 |
2.7644 |
1.7796 |
3.7587 |
| 1.7537 |
3.0997 |
2.5559 |
| H8 |
2.1312 |
3.4516 |
1.0927 |
2.7644 |
1.7796 |
3.7587 |
1.7537 |
| 2.5559 |
3.0997 |
| H9 |
2.1312 |
3.4516 |
2.7644 |
1.0927 |
3.7587 |
1.7796 |
3.0997 |
2.5559 |
| 1.7537 |
| H10 |
2.1312 |
3.4516 |
2.7644 |
1.0927 |
3.7587 |
1.7796 |
2.5559 |
3.0997 |
1.7537 |
|
Maximum atom distance is 4.2884Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S2 |
C1 |
C3 |
122.742 |
|
S2 |
C1 |
C4 |
122.742 |
|
C3 |
C1 |
C4 |
114.517 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
111.662 |
|
C1 |
C3 |
H7 |
109.595 |
|
C1 |
C3 |
H8 |
109.595 |
|
C1 |
C4 |
H6 |
111.662 |
|
C1 |
C4 |
H9 |
109.595 |
|
C1 |
C4 |
H10 |
109.595 |
|
H5 |
C3 |
H7 |
109.565 |
|
H5 |
C3 |
H8 |
109.565 |
|
H6 |
C4 |
H9 |
109.565 |
|
H6 |
C4 |
H10 |
109.565 |
|
H7 |
C3 |
H8 |
106.732 |
|
H9 |
C4 |
H10 |
106.732 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.