|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for H2OCH3OCH3 (water dimethylether dimer)
1A C1
1910171554
InChI=1S/C2H8O2/c1-4(2)5-3/h3H,1-2H3 INChIKey=WQDVWPNTHIBVKR-UHFFFAOYSA-N
B3LYP_cp_opt/aug-cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
1.4912 |
-0.0000 |
-0.0505 |
|
1.4898 |
-0.0000 |
-0.0819 |
| O2 |
2.4413 |
-0.0000 |
0.1530 |
|
2.4440 |
-0.0000 |
0.1016 |
| O3 |
-0.3986 |
0.0000 |
-0.2871 |
|
-0.4046 |
0.0000 |
-0.2787 |
| C4 |
-1.0936 |
1.1827 |
0.0717 |
|
-1.0918 |
1.1827 |
0.0947 |
| C5 |
-1.0936 |
-1.1827 |
0.0717 |
|
-1.0918 |
-1.1827 |
0.0947 |
| H6 |
2.8852 |
0.0001 |
-0.6990 |
|
2.8698 |
0.0001 |
-0.7595 |
| H7 |
-1.2600 |
1.2302 |
1.1530 |
|
-1.2354 |
1.2302 |
1.1793 |
| H8 |
-0.4773 |
2.0255 |
-0.2323 |
|
-0.4821 |
2.0255 |
-0.2222 |
| H9 |
-2.0603 |
1.2376 |
-0.4396 |
|
-2.0691 |
1.2376 |
-0.3961 |
| H10 |
-0.4773 |
-2.0255 |
-0.2324 |
|
-0.4821 |
-2.0255 |
-0.2223 |
| H11 |
-1.2599 |
-1.2302 |
1.1530 |
|
-1.2354 |
-1.2302 |
1.1793 |
| H12 |
-2.0604 |
-1.2376 |
-0.4396 |
|
-2.0692 |
-1.2376 |
-0.3961 |
Atom - Atom Distances (Å)
| |
H1 |
O2 |
O3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| H1 |
|
0.9716 |
1.9046 |
2.8451 |
2.8451 |
1.5374 |
3.2451 |
2.8303 |
3.7811 |
2.8303 |
3.2451 |
3.7811 |
| O2 |
0.9716 |
| 2.8738 |
3.7283 |
3.7283 |
0.9607 |
4.0265 |
3.5734 |
4.7061 |
3.5734 |
4.0265 |
4.7061 |
| O3 |
1.9046 |
2.8738 |
|
1.4179 |
1.4179 |
3.3095 |
2.0807 |
2.0277 |
2.0776 |
2.0277 |
2.0807 |
2.0776 |
| C4 |
2.8451 |
3.7283 |
1.4179 |
| 2.3654 |
4.2217 |
1.0951 |
1.0874 |
1.0950 |
3.2809 |
2.6494 |
2.6559 |
| C5 |
2.8451 |
3.7283 |
1.4179 |
2.3654 |
| 4.2217 |
2.6493 |
3.2809 |
2.6559 |
1.0874 |
1.0951 |
1.0950 |
| H6 |
1.5374 |
0.9607 |
3.3095 |
4.2217 |
4.2217 |
| 4.7037 |
3.9530 |
5.1046 |
3.9531 |
4.7038 |
5.1046 |
| H7 |
3.2451 |
4.0265 |
2.0807 |
1.0951 |
2.6493 |
4.7037 |
| 1.7788 |
1.7825 |
3.6237 |
2.4604 |
3.0442 |
| H8 |
2.8303 |
3.5734 |
2.0277 |
1.0874 |
3.2809 |
3.9530 |
1.7788 |
| 1.7804 |
4.0509 |
3.6237 |
3.6327 |
| H9 |
3.7811 |
4.7061 |
2.0776 |
1.0950 |
2.6559 |
5.1046 |
1.7825 |
1.7804 |
| 3.6327 |
3.0442 |
2.4752 |
| H10 |
2.8303 |
3.5734 |
2.0277 |
3.2809 |
1.0874 |
3.9531 |
3.6237 |
4.0509 |
3.6327 |
| 1.7788 |
1.7804 |
| H11 |
3.2451 |
4.0265 |
2.0807 |
2.6494 |
1.0951 |
4.7038 |
2.4604 |
3.6237 |
3.0442 |
1.7788 |
| 1.7825 |
| H12 |
3.7811 |
4.7061 |
2.0776 |
2.6559 |
1.0950 |
5.1046 |
3.0442 |
3.6327 |
2.4752 |
1.7804 |
1.7825 |
|
Maximum atom distance is 5.1046Å
between atoms H6 and H12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C4 |
O3 |
C5 |
113.047 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
O2 |
H6 |
105.426 |
|
H1 |
O3 |
C4 |
117.058 |
|
H1 |
O3 |
C5 |
117.058 |
|
O2 |
H1 |
O3 |
175.044 |
|
O3 |
C4 |
H7 |
111.132 |
|
O3 |
C4 |
H8 |
107.335 |
|
O3 |
C4 |
H9 |
110.879 |
|
O3 |
C5 |
H10 |
107.335 |
|
O3 |
C5 |
H11 |
111.132 |
|
O3 |
C5 |
H12 |
110.879 |
|
H7 |
C4 |
H8 |
109.181 |
|
H7 |
C4 |
H9 |
108.947 |
|
H8 |
C4 |
H9 |
109.327 |
|
H10 |
C5 |
H11 |
109.181 |
|
H10 |
C5 |
H12 |
109.327 |
|
H11 |
C5 |
H12 |
108.947 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.