|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3C(OH)=NH (Ethaninidic acid)
1A' CS
1910171554
InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) INChIKey=
MP2/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.1328 |
0.0000 |
|
0.1022 |
-0.0848 |
0.0000 |
| C2 |
0.9190 |
-1.0515 |
0.0000 |
|
-0.2229 |
1.3785 |
0.0000 |
| N3 |
0.2758 |
1.3761 |
0.0000 |
|
1.2354 |
-0.6659 |
0.0000 |
| O4 |
-1.2916 |
-0.2644 |
0.0000 |
|
-1.0279 |
-0.8255 |
0.0000 |
| H5 |
1.9614 |
-0.7404 |
0.0000 |
|
0.6819 |
1.9825 |
0.0000 |
| H6 |
0.7241 |
-1.6669 |
0.8792 |
|
-0.8211 |
1.6213 |
0.8792 |
| H7 |
0.7241 |
-1.6669 |
-0.8792 |
|
-0.8211 |
1.6213 |
-0.8792 |
| H8 |
1.2824 |
1.5124 |
0.0000 |
|
1.9828 |
0.0219 |
0.0000 |
| H9 |
-1.8037 |
0.5567 |
0.0000 |
|
-0.7226 |
-1.7438 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
N3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
|
1.4990 |
1.2735 |
1.3513 |
2.1470 |
2.1298 |
2.1298 |
1.8836 |
1.8528 |
| C2 |
1.4990 |
| 2.5113 |
2.3465 |
1.0879 |
1.0907 |
1.0907 |
2.5895 |
3.1621 |
| N3 |
1.2735 |
2.5113 |
| 2.2689 |
2.7057 |
3.1990 |
3.1990 |
1.0158 |
2.2351 |
| O4 |
1.3513 |
2.3465 |
2.2689 |
| 3.2876 |
2.6082 |
2.6082 |
3.1277 |
0.9677 |
| H5 |
2.1470 |
1.0879 |
2.7057 |
3.2876 |
| 1.7783 |
1.7783 |
2.3529 |
3.9823 |
| H6 |
2.1298 |
1.0907 |
3.1990 |
2.6082 |
1.7783 |
| 1.7583 |
3.3455 |
3.4795 |
| H7 |
2.1298 |
1.0907 |
3.1990 |
2.6082 |
1.7783 |
1.7583 |
| 3.3455 |
3.4795 |
| H8 |
1.8836 |
2.5895 |
1.0158 |
3.1277 |
2.3529 |
3.3455 |
3.3455 |
| 3.2306 |
| H9 |
1.8528 |
3.1621 |
2.2351 |
0.9677 |
3.9823 |
3.4795 |
3.4795 |
3.2306 |
|
Maximum atom distance is 3.9823Å
between atoms H5 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
N3 |
129.681 |
|
C2 |
C1 |
O4 |
110.715 |
|
N3 |
C1 |
O4 |
119.604 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H5 |
111.195 |
|
C1 |
C2 |
H6 |
109.649 |
|
C1 |
C2 |
H7 |
109.649 |
|
C1 |
N3 |
H8 |
110.223 |
|
C1 |
O4 |
H9 |
104.854 |
|
H5 |
C2 |
H6 |
109.424 |
|
H5 |
C2 |
H7 |
109.424 |
|
H6 |
C2 |
H7 |
107.420 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.