|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHSHCH3 (2-Propanethiol)
1A' CS
1910171554
InChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 INChIKey=KJRCEJOSASVSRA-UHFFFAOYSA-N
TPSSh/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.4150 |
0.3902 |
0.0000 |
|
0.0178 |
0.4147 |
0.3902 |
| S2 |
0.0554 |
-1.3950 |
0.0000 |
|
-0.0024 |
-0.0553 |
-1.3950 |
| H3 |
-1.5093 |
0.3340 |
0.0000 |
|
0.0645 |
1.5079 |
0.3340 |
| H4 |
1.3852 |
-1.1939 |
0.0000 |
|
-0.0592 |
-1.3840 |
-1.1939 |
| C5 |
0.0554 |
1.0961 |
1.2728 |
|
1.2692 |
-0.1098 |
1.0961 |
| C6 |
0.0554 |
1.0961 |
-1.2728 |
|
-1.2740 |
-0.0009 |
1.0961 |
| H7 |
1.1498 |
1.1287 |
1.3172 |
|
1.2668 |
-1.2051 |
1.1287 |
| H8 |
1.1498 |
1.1287 |
-1.3172 |
|
-1.3651 |
-1.0924 |
1.1287 |
| H9 |
-0.3114 |
2.1301 |
1.2876 |
|
1.2997 |
0.2560 |
2.1301 |
| H10 |
-0.3066 |
0.5840 |
2.1676 |
|
2.1787 |
0.2136 |
0.5840 |
| H11 |
-0.3114 |
2.1301 |
-1.2876 |
|
-1.2731 |
0.3661 |
2.1301 |
| H12 |
-0.3066 |
0.5840 |
-2.1676 |
|
-2.1525 |
0.3991 |
0.5840 |
Atom - Atom Distances (Å)
| |
C1 |
S2 |
H3 |
H4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
| 1.8462 |
1.0957 |
2.3980 |
1.5296 |
1.5296 |
2.1746 |
2.1746 |
2.1669 |
2.1789 |
2.1669 |
2.1789 |
| S2 |
1.8462 |
| 2.3319 |
1.3450 |
2.7975 |
2.7975 |
3.0499 |
3.0499 |
3.7708 |
2.9574 |
3.7708 |
2.9574 |
| H3 |
1.0957 |
2.3319 |
| 3.2730 |
2.1561 |
2.1561 |
3.0720 |
3.0720 |
2.5137 |
2.4914 |
2.5137 |
2.4914 |
| H4 |
2.3980 |
1.3450 |
3.2730 |
| 2.9381 |
2.9381 |
2.6804 |
2.6804 |
3.9478 |
3.2744 |
3.9478 |
3.2744 |
| C5 |
1.5296 |
2.7975 |
2.1561 |
2.9381 |
| 2.5455 |
1.0958 |
2.8119 |
1.0972 |
1.0927 |
2.7855 |
3.4970 |
| C6 |
1.5296 |
2.7975 |
2.1561 |
2.9381 |
2.5455 |
| 2.8119 |
1.0958 |
2.7855 |
3.4970 |
1.0972 |
1.0927 |
| H7 |
2.1746 |
3.0499 |
3.0720 |
2.6804 |
1.0958 |
2.8119 |
| 2.6343 |
1.7716 |
1.7723 |
3.1500 |
3.8159 |
| H8 |
2.1746 |
3.0499 |
3.0720 |
2.6804 |
2.8119 |
1.0958 |
2.6343 |
| 3.1500 |
3.8159 |
1.7716 |
1.7723 |
| H9 |
2.1669 |
3.7708 |
2.5137 |
3.9478 |
1.0972 |
2.7855 |
1.7716 |
3.1500 |
| 1.7789 |
2.5752 |
3.7853 |
| H10 |
2.1789 |
2.9574 |
2.4914 |
3.2744 |
1.0927 |
3.4970 |
1.7723 |
3.8159 |
1.7789 |
| 3.7853 |
4.3351 |
| H11 |
2.1669 |
3.7708 |
2.5137 |
3.9478 |
2.7855 |
1.0972 |
3.1500 |
1.7716 |
2.5752 |
3.7853 |
| 1.7789 |
| H12 |
2.1789 |
2.9574 |
2.4914 |
3.2744 |
3.4970 |
1.0927 |
3.8159 |
1.7723 |
3.7853 |
4.3351 |
1.7789 |
|
Maximum atom distance is 4.3351Å
between atoms H10 and H12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S2 |
C1 |
C5 |
111.587 |
|
S2 |
C1 |
C6 |
111.587 |
|
C5 |
C1 |
C6 |
112.634 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
S2 |
H4 |
96.160 |
|
C1 |
C5 |
H7 |
110.769 |
|
C1 |
C5 |
H9 |
110.081 |
|
C1 |
C5 |
H10 |
111.300 |
|
C1 |
C6 |
H8 |
110.769 |
|
C1 |
C6 |
H11 |
110.081 |
|
C1 |
C6 |
H12 |
111.300 |
|
S2 |
C1 |
H3 |
101.820 |
|
H3 |
C1 |
C5 |
109.320 |
|
H3 |
C1 |
C6 |
109.320 |
|
H7 |
C5 |
H9 |
107.773 |
|
H7 |
C5 |
H10 |
108.160 |
|
H8 |
C6 |
H11 |
107.773 |
|
H8 |
C6 |
H12 |
108.160 |
|
H9 |
C5 |
H10 |
108.653 |
|
H11 |
C6 |
H12 |
108.653 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.