|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H4F2 (orthodifluorobenzene)
1A1 C2V
1910171554
InChI=1S/C6H4F2/c7-5-3-1-2-4-6(5)8/h1-4H INChIKey=GOYDNIKZWGIXJT-UHFFFAOYSA-N
HF/6-31G(2df,p)
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.6835 |
-0.5312 |
|
-0.5312 |
0.6835 |
0.0000 |
| C2 |
0.0000 |
-0.6835 |
-0.5312 |
|
-0.5312 |
-0.6835 |
-0.0000 |
| C3 |
0.0000 |
-1.3813 |
0.6473 |
|
0.6473 |
-1.3813 |
-0.0000 |
| C4 |
0.0000 |
-0.6902 |
1.8406 |
|
1.8406 |
-0.6902 |
-0.0000 |
| C5 |
0.0000 |
0.6902 |
1.8406 |
|
1.8406 |
0.6902 |
0.0000 |
| C6 |
0.0000 |
1.3813 |
0.6473 |
|
0.6473 |
1.3813 |
0.0000 |
| F7 |
0.0000 |
1.3268 |
-1.6801 |
|
-1.6801 |
1.3268 |
0.0000 |
| F8 |
0.0000 |
-1.3268 |
-1.6801 |
|
-1.6801 |
-1.3268 |
-0.0000 |
| H9 |
0.0000 |
-2.4534 |
0.6135 |
|
0.6135 |
-2.4534 |
-0.0000 |
| H10 |
0.0000 |
-1.2319 |
2.7669 |
|
2.7669 |
-1.2319 |
-0.0000 |
| H11 |
0.0000 |
1.2319 |
2.7669 |
|
2.7669 |
1.2319 |
0.0000 |
| H12 |
0.0000 |
2.4534 |
0.6135 |
|
0.6135 |
2.4534 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
F7 |
F8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.3669 |
2.3775 |
2.7409 |
2.3718 |
1.3697 |
1.3167 |
2.3154 |
3.3392 |
3.8139 |
3.3434 |
2.1079 |
| C2 |
1.3669 |
|
1.3697 |
2.3718 |
2.7409 |
2.3775 |
2.3154 |
1.3167 |
2.1079 |
3.3434 |
3.8139 |
3.3392 |
| C3 |
2.3775 |
1.3697 |
|
1.3790 |
2.3906 |
2.7626 |
3.5708 |
2.3281 |
1.0726 |
2.1248 |
3.3647 |
3.8349 |
| C4 |
2.7409 |
2.3718 |
1.3790 |
|
1.3804 |
2.3906 |
4.0575 |
3.5778 |
2.1482 |
1.0730 |
2.1336 |
3.3746 |
| C5 |
2.3718 |
2.7409 |
2.3906 |
1.3804 |
|
1.3790 |
3.5778 |
4.0575 |
3.3746 |
2.1336 |
1.0730 |
2.1482 |
| C6 |
1.3697 |
2.3775 |
2.7626 |
2.3906 |
1.3790 |
| 2.3281 |
3.5708 |
3.8349 |
3.3647 |
2.1248 |
1.0726 |
| F7 |
1.3167 |
2.3154 |
3.5708 |
4.0575 |
3.5778 |
2.3281 |
| 2.6535 |
4.4216 |
5.1305 |
4.4480 |
2.5554 |
| F8 |
2.3154 |
1.3167 |
2.3281 |
3.5778 |
4.0575 |
3.5708 |
2.6535 |
| 2.5554 |
4.4480 |
5.1305 |
4.4216 |
| H9 |
3.3392 |
2.1079 |
1.0726 |
2.1482 |
3.3746 |
3.8349 |
4.4216 |
2.5554 |
| 2.4756 |
4.2683 |
4.9068 |
| H10 |
3.8139 |
3.3434 |
2.1248 |
1.0730 |
2.1336 |
3.3647 |
5.1305 |
4.4480 |
2.4756 |
| 2.4638 |
4.2683 |
| H11 |
3.3434 |
3.8139 |
3.3647 |
2.1336 |
1.0730 |
2.1248 |
4.4480 |
5.1305 |
4.2683 |
2.4638 |
| 2.4756 |
| H12 |
2.1079 |
3.3392 |
3.8349 |
3.3746 |
2.1482 |
1.0726 |
2.5554 |
4.4216 |
4.9068 |
4.2683 |
2.4756 |
|
Maximum atom distance is 5.1305Å
between atoms F7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
120.631 |
|
C1 |
C2 |
F8 |
119.246 |
|
C1 |
C6 |
C5 |
119.291 |
|
C2 |
C1 |
C6 |
120.631 |
|
C2 |
C1 |
F7 |
119.246 |
|
C2 |
C3 |
C4 |
119.291 |
|
C3 |
C2 |
F8 |
120.123 |
|
C3 |
C4 |
C5 |
120.078 |
|
C4 |
C5 |
C6 |
120.078 |
|
C6 |
C1 |
F7 |
120.123 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C6 |
H12 |
118.825 |
|
C2 |
C3 |
H9 |
118.825 |
|
C3 |
C4 |
H10 |
119.602 |
|
C4 |
C3 |
H9 |
121.884 |
|
C4 |
C5 |
H11 |
120.320 |
|
C5 |
C4 |
H10 |
120.320 |
|
C5 |
C6 |
H12 |
121.884 |
|
C6 |
C5 |
H11 |
119.602 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.