|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CFClCClF (trans-1,2-dichloro-1,2-difluoroethylene)
1AG C2H
1910171554
InChI=1S/C2Cl2F2/c3-1(5)2(4)6/b2-1+ INChIKey=UPVJEODAZWTJKZ-OWOJBTEDSA-N
QCISD/6-31G(2df,p)
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0697 |
0.6610 |
0.0000 |
|
0.6093 |
0.2655 |
0.0000 |
| C2 |
0.0697 |
-0.6610 |
0.0000 |
|
-0.6093 |
-0.2655 |
0.0000 |
| F3 |
-1.2562 |
1.2324 |
0.0000 |
|
1.6918 |
-0.4846 |
0.0000 |
| F4 |
1.2562 |
-1.2324 |
0.0000 |
|
-1.6918 |
0.4846 |
0.0000 |
| Cl5 |
1.2562 |
1.7402 |
0.0000 |
|
0.8937 |
1.9513 |
0.0000 |
| Cl6 |
-1.2562 |
-1.7402 |
0.0000 |
|
-0.8937 |
-1.9513 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
Cl5 |
Cl6 |
| C1 |
|
1.3293 |
1.3170 |
2.3115 |
1.7096 |
2.6783 |
| C2 |
1.3293 |
| 2.3115 |
1.3170 |
2.6783 |
1.7096 |
| F3 |
1.3170 |
2.3115 |
| 3.5196 |
2.5633 |
2.9726 |
| F4 |
2.3115 |
1.3170 |
3.5196 |
| 2.9726 |
2.5633 |
| Cl5 |
1.7096 |
2.6783 |
2.5633 |
2.9726 |
| 4.2925 |
| Cl6 |
2.6783 |
1.7096 |
2.9726 |
2.5633 |
4.2925 |
|
Maximum atom distance is 4.2925Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F4 |
121.735 |
|
C1 |
C2 |
Cl6 |
123.123 |
|
C2 |
C1 |
F3 |
121.735 |
|
C2 |
C1 |
Cl5 |
123.123 |
|
F3 |
C1 |
Cl5 |
115.142 |
|
F4 |
C2 |
Cl6 |
115.142 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.