|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
MP2=FULL/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1760 |
0.5235 |
0.0000 |
|
0.0000 |
0.3753 |
-0.4052 |
| H2 |
-1.0829 |
1.1204 |
0.0000 |
|
0.0000 |
0.4652 |
-1.4871 |
| F3 |
0.9027 |
1.3087 |
0.0000 |
|
0.0000 |
1.5812 |
0.1659 |
| Cl4 |
-0.1760 |
-0.4718 |
1.4479 |
|
1.4479 |
-0.4985 |
0.0713 |
| Cl5 |
-0.1760 |
-0.4718 |
-1.4479 |
|
-1.4479 |
-0.4985 |
0.0713 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0857 |
1.3343 |
1.7570 |
1.7570 |
| H2 |
1.0857 |
| 1.9945 |
2.3353 |
2.3353 |
| F3 |
1.3343 |
1.9945 |
| 2.5358 |
2.5358 |
| Cl4 |
1.7570 |
2.3353 |
2.5358 |
| 2.8958 |
| Cl5 |
1.7570 |
2.3353 |
2.5358 |
2.8958 |
|
Maximum atom distance is 2.8958Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
109.473 |
|
F3 |
C1 |
Cl5 |
109.473 |
|
Cl4 |
C1 |
Cl5 |
110.993 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.595 |
|
H2 |
C1 |
Cl4 |
108.146 |
|
H2 |
C1 |
Cl5 |
108.146 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.