|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2Cl (difluorochloromethane)
1A' CS
1910171554
InChI=1S/CHClF2/c2-1(3)4/h1H INChIKey=VOPWNXZWBYDODV-UHFFFAOYSA-N
mPW1PW91/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.5710 |
-0.0959 |
0.0000 |
|
0.3793 |
-0.4268 |
-0.0959 |
| H2 |
-1.4406 |
0.5630 |
0.0000 |
|
0.9570 |
-1.0768 |
0.5630 |
| Cl3 |
0.8908 |
0.9183 |
0.0000 |
|
-0.5917 |
0.6659 |
0.9183 |
| F4 |
-0.5710 |
-0.8665 |
1.0781 |
|
1.1852 |
0.2894 |
-0.8665 |
| F5 |
-0.5710 |
-0.8665 |
-1.0781 |
|
-0.4266 |
-1.1430 |
-0.8665 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Cl3 |
F4 |
F5 |
| C1 |
|
1.0911 |
1.7791 |
1.3252 |
1.3252 |
| H2 |
1.0911 |
| 2.3583 |
1.9906 |
1.9906 |
| Cl3 |
1.7791 |
2.3583 |
| 2.5465 |
2.5465 |
| F4 |
1.3252 |
1.9906 |
2.5465 |
| 2.1563 |
| F5 |
1.3252 |
1.9906 |
2.5465 |
2.1563 |
|
Maximum atom distance is 2.5465Å
between atoms Cl3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
F4 |
109.359 |
|
F3 |
C1 |
Cl5 |
109.359 |
|
F4 |
C1 |
Cl5 |
108.889 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
108.093 |
|
H2 |
C1 |
F4 |
110.560 |
|
H2 |
C1 |
Cl5 |
110.560 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.