|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CHF2 (1,1,2,2-tetrafluoroethane)
1AG C2H
1910171554
InChI=1S/C2H2F4/c3-1(4)2(5)6/h1-2H INChIKey=WXGNWUVNYMJENI-UHFFFAOYSA-N
BLYP/6-31G(2df,p)
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.2459 |
0.7305 |
0.0000 |
|
0.0330 |
-0.2436 |
0.7305 |
| C2 |
0.2459 |
-0.7305 |
0.0000 |
|
-0.0330 |
0.2436 |
-0.7305 |
| H3 |
-1.3493 |
0.7881 |
0.0000 |
|
0.1809 |
-1.3371 |
0.7881 |
| H4 |
1.3493 |
-0.7881 |
0.0000 |
|
-0.1809 |
1.3371 |
-0.7881 |
| F5 |
0.2459 |
1.3557 |
1.1108 |
|
1.0678 |
0.3926 |
1.3557 |
| F6 |
0.2459 |
1.3557 |
-1.1108 |
|
-1.1337 |
0.0947 |
1.3557 |
| F7 |
-0.2459 |
-1.3557 |
1.1108 |
|
1.1337 |
-0.0947 |
-1.3557 |
| F8 |
-0.2459 |
-1.3557 |
-1.1108 |
|
-1.0678 |
-0.3926 |
-1.3557 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
F7 |
F8 |
| C1 |
|
1.5415 |
1.1049 |
2.2024 |
1.3662 |
1.3662 |
2.3635 |
2.3635 |
| C2 |
1.5415 |
| 2.2024 |
1.1049 |
2.3635 |
2.3635 |
1.3662 |
1.3662 |
| H3 |
1.1049 |
2.2024 |
| 3.1252 |
2.0250 |
2.0250 |
2.6547 |
2.6547 |
| H4 |
2.2024 |
1.1049 |
3.1252 |
| 2.6547 |
2.6547 |
2.0250 |
2.0250 |
| F5 |
1.3662 |
2.3635 |
2.0250 |
2.6547 |
| 2.2216 |
2.7556 |
3.5396 |
| F6 |
1.3662 |
2.3635 |
2.0250 |
2.6547 |
2.2216 |
| 3.5396 |
2.7556 |
| F7 |
2.3635 |
1.3662 |
2.6547 |
2.0250 |
2.7556 |
3.5396 |
| 2.2216 |
| F8 |
2.3635 |
1.3662 |
2.6547 |
2.0250 |
3.5396 |
2.7556 |
2.2216 |
|
Maximum atom distance is 3.5396Å
between atoms F5 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F7 |
108.597 |
|
C1 |
C2 |
F8 |
108.597 |
|
C2 |
C1 |
F5 |
108.597 |
|
C2 |
C1 |
F6 |
108.597 |
|
F5 |
C1 |
F6 |
108.789 |
|
F7 |
C2 |
F8 |
108.789 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H4 |
111.589 |
|
C2 |
C1 |
H3 |
111.589 |
|
H3 |
C1 |
F5 |
109.607 |
|
H3 |
C1 |
F6 |
109.607 |
|
H4 |
C2 |
F7 |
109.607 |
|
H4 |
C2 |
F8 |
109.607 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.