|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2H5NO3 (Nitric acid, ethyl ester)
1A' C1
1910171554
InChI=1S/C2H5NO3/c1-2-6-3(4)5/h2H2,1H3 INChIKey=IDNUEBSJWINEMI-UHFFFAOYSA-N
HF/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
1.0849 |
-0.2515 |
0.0000 |
|
1.1133 |
0.0279 |
0.0000 |
| O2 |
0.0000 |
0.5106 |
0.0000 |
|
-0.1278 |
0.4944 |
0.0000 |
| O3 |
2.0894 |
0.3519 |
0.0000 |
|
1.9348 |
0.8635 |
0.0000 |
| O4 |
0.9404 |
-1.4235 |
0.0000 |
|
1.2667 |
-1.1429 |
0.0000 |
| C5 |
-1.2580 |
-0.1781 |
0.0000 |
|
-1.1734 |
-0.4872 |
0.0000 |
| C6 |
-2.3162 |
0.9041 |
0.0000 |
|
-2.4687 |
0.2958 |
0.0000 |
| H7 |
-1.3156 |
-0.8035 |
0.8792 |
|
-1.0727 |
-1.1071 |
0.8792 |
| H8 |
-1.3156 |
-0.8035 |
-0.8792 |
|
-1.0727 |
-1.1071 |
-0.8792 |
| H9 |
-3.2964 |
0.4395 |
0.0000 |
|
-3.3015 |
-0.3994 |
0.0000 |
| H10 |
-2.2297 |
1.5297 |
0.8808 |
|
-2.5416 |
0.9231 |
0.8808 |
| H11 |
-2.2297 |
1.5297 |
-0.8808 |
|
-2.5416 |
0.9231 |
-0.8808 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| N1 |
|
1.3258 |
1.1718 |
1.1808 |
2.3441 |
3.5920 |
2.6153 |
2.6153 |
4.4355 |
3.8646 |
3.8646 |
| O2 |
1.3258 |
| 2.0954 |
2.1506 |
1.4342 |
2.3494 |
2.0568 |
2.0568 |
3.2972 |
2.6050 |
2.6050 |
| O3 |
1.1718 |
2.0954 |
| 2.1147 |
3.3891 |
4.4400 |
3.7015 |
3.7015 |
5.3865 |
4.5626 |
4.5626 |
| O4 |
1.1808 |
2.1506 |
2.1147 |
| 2.5267 |
4.0029 |
2.4994 |
2.4994 |
4.6283 |
4.4211 |
4.4211 |
| C5 |
2.3441 |
1.4342 |
3.3891 |
2.5267 |
|
1.5135 |
1.0805 |
1.0805 |
2.1299 |
2.1532 |
2.1532 |
| C6 |
3.5920 |
2.3494 |
4.4400 |
4.0029 |
1.5135 |
| 2.1656 |
2.1656 |
1.0848 |
1.0838 |
1.0838 |
| H7 |
2.6153 |
2.0568 |
3.7015 |
2.4994 |
1.0805 |
2.1656 |
| 1.7584 |
2.4983 |
2.5058 |
3.0622 |
| H8 |
2.6153 |
2.0568 |
3.7015 |
2.4994 |
1.0805 |
2.1656 |
1.7584 |
| 2.4983 |
3.0622 |
2.5058 |
| H9 |
4.4355 |
3.2972 |
5.3865 |
4.6283 |
2.1299 |
1.0848 |
2.4983 |
2.4983 |
| 1.7613 |
1.7613 |
| H10 |
3.8646 |
2.6050 |
4.5626 |
4.4211 |
2.1532 |
1.0838 |
2.5058 |
3.0622 |
1.7613 |
| 1.7616 |
| H11 |
3.8646 |
2.6050 |
4.5626 |
4.4211 |
2.1532 |
1.0838 |
3.0622 |
2.5058 |
1.7613 |
1.7616 |
|
Maximum atom distance is 5.3865Å
between atoms O3 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O2 |
C5 |
116.213 |
|
O2 |
N1 |
O3 |
113.916 |
|
O2 |
N1 |
O4 |
118.060 |
|
O2 |
C5 |
C6 |
105.659 |
|
O3 |
N1 |
O4 |
128.025 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C5 |
H7 |
108.945 |
|
O2 |
C5 |
H8 |
108.945 |
|
C5 |
C6 |
H9 |
108.997 |
|
C5 |
C6 |
H10 |
110.911 |
|
C5 |
C6 |
H11 |
110.911 |
|
C6 |
C5 |
H7 |
112.123 |
|
C6 |
C5 |
H8 |
112.123 |
|
H7 |
C5 |
H8 |
108.923 |
|
H9 |
C6 |
H10 |
108.621 |
|
H9 |
C6 |
H11 |
108.621 |
|
H10 |
C6 |
H11 |
108.722 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.