|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2Br4 (tetrabromoethene)
1AG D2H
1910171554
InChI=1S/C2Br4/c3-1(4)2(5)6 INChIKey=OVRRJBSHBOXFQE-UHFFFAOYSA-N
MP2/6-31G(2df,p)
Point group is D2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.6770 |
|
0.6770 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
-0.6770 |
|
-0.6770 |
0.0000 |
0.0000 |
| Br3 |
0.0000 |
1.5650 |
1.6586 |
|
1.6586 |
1.5650 |
0.0000 |
| Br4 |
0.0000 |
-1.5650 |
1.6586 |
|
1.6586 |
-1.5650 |
0.0000 |
| Br5 |
0.0000 |
-1.5650 |
-1.6586 |
|
-1.6586 |
-1.5650 |
0.0000 |
| Br6 |
0.0000 |
1.5650 |
-1.6586 |
|
-1.6586 |
1.5650 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
Br3 |
Br4 |
Br5 |
Br6 |
| C1 |
|
1.3540 |
1.8474 |
1.8474 |
2.8115 |
2.8115 |
| C2 |
1.3540 |
| 2.8115 |
2.8115 |
1.8474 |
1.8474 |
| Br3 |
1.8474 |
2.8115 |
| 3.1300 |
4.5608 |
3.3172 |
| Br4 |
1.8474 |
2.8115 |
3.1300 |
| 3.3172 |
4.5608 |
| Br5 |
2.8115 |
1.8474 |
4.5608 |
3.3172 |
| 3.1300 |
| Br6 |
2.8115 |
1.8474 |
3.3172 |
4.5608 |
3.1300 |
|
Maximum atom distance is 4.5608Å
between atoms Br3 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
Br5 |
122.097 |
|
C1 |
C2 |
Br6 |
122.097 |
|
C2 |
C1 |
Br3 |
122.097 |
|
C2 |
C1 |
Br4 |
122.097 |
|
Br3 |
C1 |
Br4 |
115.806 |
|
Br5 |
C2 |
Br6 |
115.806 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.