|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
HF/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1014 |
0.7747 |
0.0000 |
|
-0.3369 |
0.6976 |
-0.1014 |
| H2 |
-0.9910 |
1.3766 |
0.0000 |
|
-0.5986 |
1.2396 |
-0.9910 |
| F3 |
0.9667 |
1.5527 |
0.0000 |
|
-0.6752 |
1.3982 |
0.9667 |
| Br4 |
-0.1014 |
-0.2857 |
1.5823 |
|
1.5491 |
0.4308 |
-0.1014 |
| Br5 |
-0.1014 |
-0.2857 |
-1.5823 |
|
-1.3006 |
-0.9453 |
-0.1014 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0741 |
1.3215 |
1.9047 |
1.9047 |
| H2 |
1.0741 |
| 1.9656 |
2.4613 |
2.4613 |
| F3 |
1.3215 |
1.9656 |
| 2.6504 |
2.6504 |
| Br4 |
1.9047 |
2.4613 |
2.6504 |
| 3.1645 |
| Br5 |
1.9047 |
2.4613 |
2.6504 |
3.1645 |
|
Maximum atom distance is 3.1645Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.134 |
|
F3 |
C1 |
Br5 |
109.134 |
|
Br4 |
C1 |
Br5 |
112.342 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.846 |
|
H2 |
C1 |
Br4 |
108.179 |
|
H2 |
C1 |
Br5 |
108.179 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.