|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOH (Acetic acid)
1A' CS
1910171554
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) INChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N
TPSSh/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.9834 |
-0.9977 |
0.0000 |
|
-1.3957 |
0.1195 |
0.0000 |
| C2 |
0.0000 |
0.1435 |
0.0000 |
|
0.0932 |
-0.1091 |
0.0000 |
| O3 |
0.3110 |
1.3183 |
0.0000 |
|
0.6201 |
-1.2042 |
0.0000 |
| H4 |
1.9782 |
-0.5608 |
0.0000 |
|
-1.8682 |
-0.8590 |
0.0000 |
| H5 |
0.8486 |
-1.6308 |
0.8831 |
|
-1.7046 |
0.6884 |
0.8831 |
| H6 |
0.8486 |
-1.6308 |
-0.8831 |
|
-1.7046 |
0.6884 |
-0.8831 |
| O7 |
-1.2842 |
-0.2695 |
0.0000 |
|
0.8011 |
1.0392 |
0.0000 |
| H8 |
-1.7897 |
0.5575 |
0.0000 |
|
1.7226 |
0.7390 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
H4 |
H5 |
H6 |
O7 |
H8 |
| C1 |
|
1.5064 |
2.4116 |
1.0866 |
1.0949 |
1.0949 |
2.3816 |
3.1793 |
| C2 |
1.5064 |
|
1.2153 |
2.0999 |
2.1559 |
2.1559 |
1.3490 |
1.8369 |
| O3 |
2.4116 |
1.2153 |
| 2.5121 |
3.1251 |
3.1251 |
2.2507 |
2.2342 |
| H4 |
1.0866 |
2.0999 |
2.5121 |
| 1.7891 |
1.7891 |
3.2754 |
3.9303 |
| H5 |
1.0949 |
2.1559 |
3.1251 |
1.7891 |
| 1.7661 |
2.6799 |
3.5396 |
| H6 |
1.0949 |
2.1559 |
3.1251 |
1.7891 |
1.7661 |
| 2.6799 |
3.5396 |
| O7 |
2.3816 |
1.3490 |
2.2507 |
3.2754 |
2.6799 |
2.6799 |
|
0.9692 |
| H8 |
3.1793 |
1.8369 |
2.2342 |
3.9303 |
3.5396 |
3.5396 |
0.9692 |
|
Maximum atom distance is 3.9303Å
between atoms H4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
124.422 |
|
C1 |
C2 |
O7 |
112.923 |
|
O3 |
C2 |
O7 |
122.655 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H4 |
107.043 |
|
C2 |
C1 |
H5 |
110.959 |
|
C2 |
C1 |
H6 |
110.959 |
|
C2 |
O7 |
H8 |
103.605 |
|
H4 |
C1 |
H5 |
110.195 |
|
H4 |
C1 |
H6 |
110.195 |
|
H5 |
C1 |
H6 |
107.514 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.