|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H4O2 (4-Cyclopentene-1,3-dione)
1A1 C2V
1910171554
InChI=1S/C5H4O2/c6-4-1-2-5(7)3-4/h1-2H,3H2 INChIKey=MCFZBCCYOPSZLG-UHFFFAOYSA-N
MP2=FULL/6-31G(2df,p)
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.0809 |
|
1.0809 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
1.1944 |
0.1485 |
|
0.1485 |
0.0000 |
1.1944 |
| C3 |
0.0000 |
-1.1944 |
0.1485 |
|
0.1485 |
0.0000 |
-1.1944 |
| C4 |
0.0000 |
0.6712 |
-1.2409 |
|
-1.2409 |
0.0000 |
0.6712 |
| C5 |
0.0000 |
-0.6712 |
-1.2409 |
|
-1.2409 |
0.0000 |
-0.6712 |
| O6 |
0.0000 |
2.3639 |
0.4610 |
|
0.4610 |
0.0000 |
2.3639 |
| O7 |
0.0000 |
-2.3639 |
0.4610 |
|
0.4610 |
0.0000 |
-2.3639 |
| H8 |
0.8813 |
0.0000 |
1.7224 |
|
1.7224 |
0.8813 |
0.0000 |
| H9 |
-0.8813 |
0.0000 |
1.7224 |
|
1.7224 |
-0.8813 |
0.0000 |
| H10 |
0.0000 |
1.3290 |
-2.0982 |
|
-2.0982 |
0.0000 |
1.3290 |
| H11 |
0.0000 |
-1.3290 |
-2.0982 |
|
-2.0982 |
0.0000 |
-1.3290 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
O6 |
O7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5153 |
1.5153 |
2.4169 |
2.4169 |
2.4439 |
2.4439 |
1.0900 |
1.0900 |
3.4457 |
3.4457 |
| C2 |
1.5153 |
| 2.3889 |
1.4847 |
2.3261 |
1.2105 |
3.5721 |
2.1635 |
2.1635 |
2.2507 |
3.3786 |
| C3 |
1.5153 |
2.3889 |
| 2.3261 |
1.4847 |
3.5721 |
1.2105 |
2.1635 |
2.1635 |
3.3786 |
2.2507 |
| C4 |
2.4169 |
1.4847 |
2.3261 |
|
1.3423 |
2.4004 |
3.4797 |
3.1636 |
3.1636 |
1.0806 |
2.1761 |
| C5 |
2.4169 |
2.3261 |
1.4847 |
1.3423 |
| 3.4797 |
2.4004 |
3.1636 |
3.1636 |
2.1761 |
1.0806 |
| O6 |
2.4439 |
1.2105 |
3.5721 |
2.4004 |
3.4797 |
| 4.7278 |
2.8206 |
2.8206 |
2.7605 |
4.4930 |
| O7 |
2.4439 |
3.5721 |
1.2105 |
3.4797 |
2.4004 |
4.7278 |
| 2.8206 |
2.8206 |
4.4930 |
2.7605 |
| H8 |
1.0900 |
2.1635 |
2.1635 |
3.1636 |
3.1636 |
2.8206 |
2.8206 |
| 1.7626 |
4.1400 |
4.1400 |
| H9 |
1.0900 |
2.1635 |
2.1635 |
3.1636 |
3.1636 |
2.8206 |
2.8206 |
1.7626 |
| 4.1400 |
4.1400 |
| H10 |
3.4457 |
2.2507 |
3.3786 |
1.0806 |
2.1761 |
2.7605 |
4.4930 |
4.1400 |
4.1400 |
| 2.6580 |
| H11 |
3.4457 |
3.3786 |
2.2507 |
2.1761 |
1.0806 |
4.4930 |
2.7605 |
4.1400 |
4.1400 |
2.6580 |
|
Maximum atom distance is 4.7278Å
between atoms O6 and O7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
107.341 |
|
C1 |
C2 |
O6 |
127.060 |
|
C1 |
C3 |
C5 |
107.341 |
|
C1 |
C3 |
O7 |
127.060 |
|
C2 |
C1 |
C3 |
104.043 |
|
C2 |
C4 |
C5 |
110.638 |
|
C3 |
C5 |
C4 |
110.638 |
|
C4 |
C2 |
O6 |
125.599 |
|
C5 |
C3 |
O7 |
125.599 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H8 |
111.231 |
|
C2 |
C1 |
H9 |
111.231 |
|
C2 |
C4 |
H10 |
121.861 |
|
C3 |
C1 |
H8 |
111.231 |
|
C3 |
C1 |
H9 |
111.231 |
|
C3 |
C5 |
H11 |
121.861 |
|
C4 |
C5 |
H11 |
127.501 |
|
C5 |
C4 |
H10 |
127.501 |
|
H8 |
C1 |
H9 |
107.902 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.