|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
BLYP/6-31G(2df,p)
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1915 |
|
0.0000 |
0.1915 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4122 |
|
0.0000 |
1.4122 |
0.0000 |
| C3 |
0.0000 |
1.3001 |
-0.6203 |
|
1.3001 |
-0.6203 |
-0.0000 |
| C4 |
0.0000 |
-1.3001 |
-0.6203 |
|
-1.3001 |
-0.6203 |
0.0000 |
| H5 |
0.0018 |
2.1644 |
0.0555 |
|
2.1644 |
0.0555 |
0.0017 |
| H6 |
-0.0018 |
-2.1644 |
0.0555 |
|
-2.1644 |
0.0555 |
-0.0017 |
| H7 |
0.8837 |
1.3427 |
-1.2793 |
|
1.3428 |
-1.2793 |
0.8837 |
| H8 |
-0.8848 |
1.3443 |
-1.2775 |
|
1.3443 |
-1.2775 |
-0.8849 |
| H9 |
-0.8837 |
-1.3427 |
-1.2793 |
|
-1.3428 |
-1.2793 |
-0.8837 |
| H10 |
0.8848 |
-1.3443 |
-1.2775 |
|
-1.3443 |
-1.2775 |
0.8849 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2207 |
1.5327 |
1.5327 |
2.1687 |
2.1687 |
2.1788 |
2.1790 |
2.1788 |
2.1790 |
| O2 |
1.2207 |
| 2.4127 |
2.4127 |
2.5545 |
2.5545 |
3.1349 |
3.1344 |
3.1349 |
3.1344 |
| C3 |
1.5327 |
2.4127 |
| 2.6001 |
1.0972 |
3.5298 |
1.1032 |
1.1031 |
2.8635 |
2.8649 |
| C4 |
1.5327 |
2.4127 |
2.6001 |
| 3.5298 |
1.0972 |
2.8635 |
2.8649 |
1.1032 |
1.1031 |
| H5 |
2.1687 |
2.5545 |
1.0972 |
3.5298 |
| 4.3289 |
1.7985 |
1.7988 |
3.8556 |
3.8559 |
| H6 |
2.1687 |
2.5545 |
3.5298 |
1.0972 |
4.3289 |
| 3.8556 |
3.8559 |
1.7985 |
1.7988 |
| H7 |
2.1788 |
3.1349 |
1.1032 |
2.8635 |
1.7985 |
3.8556 |
| 1.7686 |
3.2149 |
2.6871 |
| H8 |
2.1790 |
3.1344 |
1.1031 |
2.8649 |
1.7988 |
3.8559 |
1.7686 |
| 2.6871 |
3.2188 |
| H9 |
2.1788 |
3.1349 |
2.8635 |
1.1032 |
3.8556 |
1.7985 |
3.2149 |
2.6871 |
| 1.7686 |
| H10 |
2.1790 |
3.1344 |
2.8649 |
1.1031 |
3.8559 |
1.7988 |
2.6871 |
3.2188 |
1.7686 |
|
Maximum atom distance is 4.3289Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.982 |
|
O2 |
C1 |
C4 |
121.982 |
|
C3 |
C1 |
C4 |
116.036 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.997 |
|
C1 |
C3 |
H7 |
110.437 |
|
C1 |
C3 |
H8 |
110.463 |
|
C1 |
C4 |
H6 |
109.997 |
|
C1 |
C4 |
H9 |
110.437 |
|
C1 |
C4 |
H10 |
110.463 |
|
H5 |
C3 |
H7 |
109.644 |
|
H5 |
C3 |
H8 |
109.674 |
|
H6 |
C4 |
H9 |
109.644 |
|
H6 |
C4 |
H10 |
109.674 |
|
H7 |
C3 |
H8 |
106.566 |
|
H9 |
C4 |
H10 |
106.566 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.