|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CF2 (Ethene, 1,1-difluoro-)
1A1 C2V
1910171554
InChI=1S/C2H2F2/c1-2(3)4/h1H2 INChIKey=BQCIDUSAKPWEOX-UHFFFAOYSA-N
mPW1PW91/3-21G
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.3879 |
|
1.3879 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
0.0729 |
|
0.0729 |
0.0000 |
0.0000 |
| H3 |
0.0000 |
0.9338 |
1.9259 |
|
1.9259 |
0.9338 |
0.0000 |
| H4 |
0.0000 |
-0.9338 |
1.9259 |
|
1.9259 |
-0.9338 |
0.0000 |
| F5 |
0.0000 |
1.1012 |
-0.7009 |
|
-0.7009 |
1.1012 |
0.0000 |
| F6 |
0.0000 |
-1.1012 |
-0.7009 |
|
-0.7009 |
-1.1012 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
| C1 |
|
1.3150 |
1.0777 |
1.0777 |
2.3613 |
2.3613 |
| C2 |
1.3150 |
| 2.0750 |
2.0750 |
1.3459 |
1.3459 |
| H3 |
1.0777 |
2.0750 |
| 1.8677 |
2.6321 |
3.3228 |
| H4 |
1.0777 |
2.0750 |
1.8677 |
| 3.3228 |
2.6321 |
| F5 |
2.3613 |
1.3459 |
2.6321 |
3.3228 |
| 2.2024 |
| F6 |
2.3613 |
1.3459 |
3.3228 |
2.6321 |
2.2024 |
|
Maximum atom distance is 3.3228Å
between atoms H3 and F6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F5 |
125.095 |
|
C1 |
C2 |
F6 |
125.095 |
|
F5 |
C2 |
F6 |
109.810 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H3 |
119.945 |
|
C2 |
C1 |
H4 |
119.945 |
|
H3 |
C1 |
H4 |
120.111 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.