|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOH (Acetic acid)
1A' CS
1910171554
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) INChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N
mPW1PW91/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.1360 |
-0.8162 |
0.0000 |
|
-1.3922 |
-0.1358 |
0.0000 |
| C2 |
0.0000 |
0.1649 |
0.0000 |
|
0.1088 |
-0.1240 |
0.0000 |
| O3 |
0.0614 |
1.3844 |
0.0000 |
|
0.8669 |
-1.0811 |
0.0000 |
| H4 |
2.0823 |
-0.2785 |
0.0000 |
|
-1.7489 |
-1.1641 |
0.0000 |
| H5 |
1.0636 |
-1.4583 |
0.8821 |
|
-1.7613 |
0.3946 |
0.8821 |
| H6 |
1.0636 |
-1.4583 |
-0.8821 |
|
-1.7613 |
0.3946 |
-0.8821 |
| O7 |
-1.1977 |
-0.5152 |
0.0000 |
|
0.5605 |
1.1772 |
0.0000 |
| H8 |
-1.9353 |
0.1493 |
0.0000 |
|
1.5531 |
1.1642 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
H4 |
H5 |
H6 |
O7 |
H8 |
| C1 |
|
1.5011 |
2.4490 |
1.0884 |
1.0935 |
1.0935 |
2.3531 |
3.2195 |
| C2 |
1.5011 |
|
1.2210 |
2.1290 |
2.1318 |
2.1318 |
1.3773 |
1.9353 |
| O3 |
2.4490 |
1.2210 |
| 2.6172 |
3.1406 |
3.1406 |
2.2789 |
2.3478 |
| H4 |
1.0884 |
2.1290 |
2.6172 |
| 1.7910 |
1.7910 |
3.2886 |
4.0403 |
| H5 |
1.0935 |
2.1318 |
3.1406 |
1.7910 |
| 1.7643 |
2.6041 |
3.5151 |
| H6 |
1.0935 |
2.1318 |
3.1406 |
1.7910 |
1.7643 |
| 2.6041 |
3.5151 |
| O7 |
2.3531 |
1.3773 |
2.2789 |
3.2886 |
2.6041 |
2.6041 |
|
0.9927 |
| H8 |
3.2195 |
1.9353 |
2.3478 |
4.0403 |
3.5151 |
3.5151 |
0.9927 |
|
Maximum atom distance is 4.0403Å
between atoms H4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
127.933 |
|
C1 |
C2 |
O7 |
109.596 |
|
O3 |
C2 |
O7 |
122.471 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H4 |
109.581 |
|
C2 |
C1 |
H5 |
109.494 |
|
C2 |
C1 |
H6 |
109.494 |
|
C2 |
O7 |
H8 |
108.395 |
|
H4 |
C1 |
H5 |
110.344 |
|
H4 |
C1 |
H6 |
110.344 |
|
H5 |
C1 |
H6 |
107.552 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.