|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
CID/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1830 |
0.5760 |
0.0000 |
|
-0.2811 |
0.5027 |
-0.1830 |
| H2 |
-1.0977 |
1.1480 |
0.0000 |
|
-0.5604 |
1.0019 |
-1.0977 |
| F3 |
0.9351 |
1.3651 |
0.0000 |
|
-0.6663 |
1.1915 |
0.9351 |
| Cl4 |
-0.1830 |
-0.4968 |
1.5328 |
|
1.5802 |
0.3146 |
-0.1830 |
| Cl5 |
-0.1830 |
-0.4968 |
-1.5328 |
|
-1.0953 |
-1.1817 |
-0.1830 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0789 |
1.3685 |
1.8709 |
1.8709 |
| H2 |
1.0789 |
| 2.0443 |
2.4272 |
2.4272 |
| F3 |
1.3685 |
2.0443 |
| 2.6582 |
2.6582 |
| Cl4 |
1.8709 |
2.4272 |
2.6582 |
| 3.0655 |
| Cl5 |
1.8709 |
2.4272 |
2.6582 |
3.0655 |
|
Maximum atom distance is 3.0655Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
109.308 |
|
F3 |
C1 |
Cl5 |
109.308 |
|
Cl4 |
C1 |
Cl5 |
110.027 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
112.763 |
|
H2 |
C1 |
Cl4 |
107.699 |
|
H2 |
C1 |
Cl5 |
107.699 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.