|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
QCISD/3-21G
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1923 |
|
0.1923 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4377 |
|
1.4377 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2953 |
-0.6353 |
|
-0.6353 |
0.0000 |
1.2953 |
| C4 |
0.0000 |
-1.2953 |
-0.6353 |
|
-0.6353 |
0.0000 |
-1.2953 |
| H5 |
0.0000 |
2.1551 |
0.0444 |
|
0.0444 |
0.0000 |
2.1551 |
| H6 |
0.0000 |
-2.1551 |
0.0444 |
|
0.0444 |
0.0000 |
-2.1551 |
| H7 |
0.8907 |
1.3300 |
-1.2801 |
|
-1.2801 |
0.8907 |
1.3300 |
| H8 |
-0.8907 |
1.3300 |
-1.2801 |
|
-1.2801 |
-0.8907 |
1.3300 |
| H9 |
-0.8907 |
-1.3300 |
-1.2801 |
|
-1.2801 |
-0.8907 |
-1.3300 |
| H10 |
0.8907 |
-1.3300 |
-1.2801 |
|
-1.2801 |
0.8907 |
-1.3300 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2454 |
1.5371 |
1.5371 |
2.1601 |
2.1601 |
2.1749 |
2.1749 |
2.1749 |
2.1749 |
| O2 |
1.2454 |
| 2.4444 |
2.4444 |
2.5663 |
2.5663 |
3.1542 |
3.1542 |
3.1542 |
3.1542 |
| C3 |
1.5371 |
2.4444 |
| 2.5905 |
1.0961 |
3.5166 |
1.1001 |
1.1001 |
2.8462 |
2.8462 |
| C4 |
1.5371 |
2.4444 |
2.5905 |
| 3.5166 |
1.0961 |
2.8462 |
2.8462 |
1.1001 |
1.1001 |
| H5 |
2.1601 |
2.5663 |
1.0961 |
3.5166 |
| 4.3101 |
1.7968 |
1.7968 |
3.8332 |
3.8332 |
| H6 |
2.1601 |
2.5663 |
3.5166 |
1.0961 |
4.3101 |
| 3.8332 |
3.8332 |
1.7968 |
1.7968 |
| H7 |
2.1749 |
3.1542 |
1.1001 |
2.8462 |
1.7968 |
3.8332 |
| 1.7814 |
3.2014 |
2.6600 |
| H8 |
2.1749 |
3.1542 |
1.1001 |
2.8462 |
1.7968 |
3.8332 |
1.7814 |
| 2.6600 |
3.2014 |
| H9 |
2.1749 |
3.1542 |
2.8462 |
1.1001 |
3.8332 |
1.7968 |
3.2014 |
2.6600 |
| 1.7814 |
| H10 |
2.1749 |
3.1542 |
2.8462 |
1.1001 |
3.8332 |
1.7968 |
2.6600 |
3.2014 |
1.7814 |
|
Maximum atom distance is 4.3101Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
122.579 |
|
O2 |
C1 |
C4 |
122.579 |
|
C3 |
C1 |
C4 |
114.843 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.092 |
|
C1 |
C3 |
H7 |
110.009 |
|
C1 |
C3 |
H8 |
110.009 |
|
C1 |
C4 |
H6 |
109.092 |
|
C1 |
C4 |
H9 |
110.009 |
|
C1 |
C4 |
H10 |
110.009 |
|
H5 |
C3 |
H7 |
109.798 |
|
H5 |
C3 |
H8 |
109.798 |
|
H6 |
C4 |
H9 |
109.798 |
|
H6 |
C4 |
H10 |
109.798 |
|
H7 |
C3 |
H8 |
108.122 |
|
H9 |
C4 |
H10 |
108.122 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.