|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHClCH3 (Propane, 2-chloro-)
1A' CS
1910171554
InChI=1S/C3H7Cl/c1-3(2)4/h3H,1-2H3 INChIKey=ULYZAYCEDJDHCC-UHFFFAOYSA-N
MP4/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| Cl1 |
-0.9795 |
1.0111 |
0.0000 |
|
1.4071 |
0.0000 |
-0.0433 |
| C2 |
0.6331 |
-0.0624 |
0.0000 |
|
-0.4725 |
0.0000 |
0.4260 |
| C3 |
0.6331 |
-0.9021 |
1.2873 |
|
-1.0932 |
1.2873 |
-0.1395 |
| C4 |
0.6331 |
-0.9021 |
-1.2873 |
|
-1.0932 |
-1.2873 |
-0.1395 |
| H5 |
1.4309 |
0.6862 |
0.0000 |
|
-0.4563 |
0.0000 |
1.5199 |
| H6 |
1.5567 |
-1.5007 |
1.3252 |
|
-2.1577 |
1.3252 |
0.1402 |
| H7 |
1.5567 |
-1.5007 |
-1.3252 |
|
-2.1577 |
-1.3252 |
0.1402 |
| H8 |
0.5880 |
-0.2581 |
2.1744 |
|
-0.5867 |
2.1744 |
0.2609 |
| H9 |
0.5880 |
-0.2581 |
-2.1744 |
|
-0.5867 |
-2.1744 |
0.2609 |
| H10 |
-0.2317 |
-1.5787 |
1.2927 |
|
-1.0111 |
1.2927 |
-1.2344 |
| H11 |
-0.2317 |
-1.5787 |
-1.2927 |
|
-1.0111 |
-1.2927 |
-1.2344 |
Atom - Atom Distances (Å)
| |
Cl1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| Cl1 |
| 1.9372 |
2.8138 |
2.8138 |
2.4322 |
3.8076 |
3.8076 |
2.9658 |
2.9658 |
2.9895 |
2.9895 |
| C2 |
1.9372 |
|
1.5369 |
1.5369 |
1.0940 |
2.1629 |
2.1629 |
2.1836 |
2.1836 |
2.1721 |
2.1721 |
| C3 |
2.8138 |
1.5369 |
| 2.5746 |
2.1946 |
1.1013 |
2.8349 |
1.0971 |
3.5214 |
1.0980 |
2.8039 |
| C4 |
2.8138 |
1.5369 |
2.5746 |
| 2.1946 |
2.8349 |
1.1013 |
3.5214 |
1.0971 |
2.8039 |
1.0980 |
| H5 |
2.4322 |
1.0940 |
2.1946 |
2.1946 |
| 2.5602 |
2.5602 |
2.5160 |
2.5160 |
3.0927 |
3.0927 |
| H6 |
3.8076 |
2.1629 |
1.1013 |
2.8349 |
2.5602 |
| 2.6504 |
1.7899 |
3.8379 |
1.7903 |
3.1714 |
| H7 |
3.8076 |
2.1629 |
2.8349 |
1.1013 |
2.5602 |
2.6504 |
| 3.8379 |
1.7899 |
3.1714 |
1.7903 |
| H8 |
2.9658 |
2.1836 |
1.0971 |
3.5214 |
2.5160 |
1.7899 |
3.8379 |
| 4.3488 |
1.7870 |
3.7996 |
| H9 |
2.9658 |
2.1836 |
3.5214 |
1.0971 |
2.5160 |
3.8379 |
1.7899 |
4.3488 |
| 3.7996 |
1.7870 |
| H10 |
2.9895 |
2.1721 |
1.0980 |
2.8039 |
3.0927 |
1.7903 |
3.1714 |
1.7870 |
3.7996 |
| 2.5854 |
| H11 |
2.9895 |
2.1721 |
2.8039 |
1.0980 |
3.0927 |
3.1714 |
1.7903 |
3.7996 |
1.7870 |
2.5854 |
|
Maximum atom distance is 4.3488Å
between atoms H8 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C2 |
C3 |
107.621 |
|
Cl1 |
C2 |
C4 |
107.621 |
|
C3 |
C2 |
C4 |
113.771 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C3 |
H5 |
56.491 |
|
C2 |
C3 |
H6 |
109.015 |
|
C2 |
C3 |
H8 |
110.889 |
|
C2 |
C3 |
H10 |
109.925 |
|
C2 |
C4 |
H7 |
109.015 |
|
C2 |
C4 |
H9 |
110.889 |
|
C2 |
C4 |
H11 |
109.925 |
|
C3 |
C2 |
H5 |
111.952 |
|
C4 |
C2 |
H5 |
111.952 |
|
H6 |
C3 |
H8 |
109.009 |
|
H6 |
C3 |
H10 |
108.984 |
|
H7 |
C4 |
H9 |
109.009 |
|
H7 |
C4 |
H11 |
108.984 |
|
H8 |
C3 |
H10 |
108.987 |
|
H9 |
C4 |
H11 |
108.987 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.