|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NO3- (nitrate anion)
1A1' D3H
1910171554
InChI=1S/NO3/c2-1(3)4/q-1 INChIKey=NHNBFGGVMKEFGY-UHFFFAOYSA-N
wB97X-D/3-21G
Point group is D3h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.0000 |
0.0000 |
|
0.0000 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
1.3087 |
0.0000 |
|
0.0000 |
1.3087 |
0.0000 |
| O3 |
1.1333 |
-0.6543 |
0.0000 |
|
1.1333 |
-0.6543 |
0.0000 |
| O4 |
-1.1333 |
-0.6543 |
0.0000 |
|
-1.1333 |
-0.6543 |
0.0000 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
| N1 |
|
1.3087 |
1.3087 |
1.3087 |
| O2 |
1.3087 |
| 2.2667 |
2.2667 |
| O3 |
1.3087 |
2.2667 |
| 2.2667 |
| O4 |
1.3087 |
2.2667 |
2.2667 |
|
Maximum atom distance is 2.2667Å
between atoms O3 and O4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
N1 |
O3 |
120.000 |
|
O2 |
N1 |
O4 |
120.000 |
|
O3 |
N1 |
O4 |
120.000 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.