|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOCH3 (methyl acetate)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 INChIKey=KXKVLQRXCPHEJC-UHFFFAOYSA-N
BLYP/3-21G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.2086 |
1.4661 |
0.0000 |
|
0.9969 |
1.6175 |
0.0000 |
| C2 |
0.0000 |
0.5325 |
0.0000 |
|
0.5039 |
0.1721 |
0.0000 |
| O3 |
-1.1973 |
0.8434 |
0.0000 |
|
1.1850 |
-0.8605 |
0.0000 |
| O4 |
0.4767 |
-0.7964 |
0.0000 |
|
-0.9077 |
0.1938 |
0.0000 |
| C5 |
-0.5887 |
-1.8527 |
0.0000 |
|
-1.5632 |
-1.1558 |
0.0000 |
| H6 |
0.8642 |
2.5073 |
0.0000 |
|
2.0936 |
1.6280 |
0.0000 |
| H7 |
1.8272 |
1.2675 |
0.8893 |
|
0.6092 |
2.1387 |
0.8893 |
| H8 |
1.8272 |
1.2675 |
-0.8893 |
|
0.6092 |
2.1387 |
-0.8893 |
| H9 |
-1.5731 |
-1.3641 |
0.0000 |
|
-0.7827 |
-1.9295 |
0.0000 |
| H10 |
-0.4501 |
-2.4646 |
-0.9027 |
|
-2.1870 |
-1.2223 |
-0.9027 |
| H11 |
-0.4501 |
-2.4646 |
0.9027 |
|
-2.1870 |
-1.2223 |
0.9027 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5272 |
2.4851 |
2.3779 |
3.7742 |
1.0967 |
1.1014 |
1.1014 |
3.9684 |
4.3608 |
4.3608 |
| C2 |
1.5272 |
|
1.2370 |
1.4118 |
2.4568 |
2.1556 |
2.1610 |
2.1610 |
2.4641 |
3.1623 |
3.1623 |
| O3 |
2.4851 |
1.2370 |
| 2.3432 |
2.7639 |
2.6492 |
3.1809 |
3.1809 |
2.2393 |
3.5094 |
3.5094 |
| O4 |
2.3779 |
1.4118 |
2.3432 |
|
1.5003 |
3.3263 |
2.6219 |
2.6219 |
2.1269 |
2.1111 |
2.1111 |
| C5 |
3.7742 |
2.4568 |
2.7639 |
1.5003 |
| 4.5957 |
4.0452 |
4.0452 |
1.0990 |
1.0993 |
1.0993 |
| H6 |
1.0967 |
2.1556 |
2.6492 |
3.3263 |
4.5957 |
| 1.8042 |
1.8042 |
4.5747 |
5.2213 |
5.2213 |
| H7 |
1.1014 |
2.1610 |
3.1809 |
2.6219 |
4.0452 |
1.8042 |
| 1.7787 |
4.3907 |
4.7251 |
4.3721 |
| H8 |
1.1014 |
2.1610 |
3.1809 |
2.6219 |
4.0452 |
1.8042 |
1.7787 |
| 4.3907 |
4.3721 |
4.7251 |
| H9 |
3.9684 |
2.4641 |
2.2393 |
2.1269 |
1.0990 |
4.5747 |
4.3907 |
4.3907 |
| 1.8130 |
1.8130 |
| H10 |
4.3608 |
3.1623 |
3.5094 |
2.1111 |
1.0993 |
5.2213 |
4.7251 |
4.3721 |
1.8130 |
| 1.8053 |
| H11 |
4.3608 |
3.1623 |
3.5094 |
2.1111 |
1.0993 |
5.2213 |
4.3721 |
4.7251 |
1.8130 |
1.8053 |
|
Maximum atom distance is 5.2213Å
between atoms H6 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
127.758 |
|
C1 |
C2 |
O4 |
107.953 |
|
C2 |
O4 |
C5 |
115.025 |
|
O3 |
C2 |
O4 |
124.289 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H6 |
109.384 |
|
C2 |
C1 |
H7 |
109.528 |
|
C2 |
C1 |
H8 |
109.528 |
|
O4 |
C5 |
H9 |
108.844 |
|
O4 |
C5 |
H10 |
107.601 |
|
O4 |
C5 |
H11 |
107.601 |
|
H6 |
C1 |
H7 |
110.338 |
|
H6 |
C1 |
H8 |
110.338 |
|
H7 |
C1 |
H8 |
107.701 |
|
H9 |
C5 |
H10 |
111.128 |
|
H9 |
C5 |
H11 |
111.128 |
|
H10 |
C5 |
H11 |
110.396 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.